[(2R,3R,4R)-2,3,4,5-tetrahydroxypentyl] (2E,4S,5S,6E,8S,9S,10E,12S,13R,14S,16S,18S)-13-[(2R,3S,4S,5S,6R)-6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5,9-dihydroxy-2,4,6,8,10,12,14,16,18-nonamethylicosa-2,6,10-trienoate
Internal ID | c45c66df-9ec5-4c64-a27e-9309454ed7fa |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
IUPAC Name | [(2R,3R,4R)-2,3,4,5-tetrahydroxypentyl] (2E,4S,5S,6E,8S,9S,10E,12S,13R,14S,16S,18S)-13-[(2R,3S,4S,5S,6R)-6-(acetyloxymethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-5,9-dihydroxy-2,4,6,8,10,12,14,16,18-nonamethylicosa-2,6,10-trienoate |
SMILES (Canonical) | CCC(C)CC(C)CC(C)C(C(C)C=C(C)C(C(C)C=C(C)C(C(C)C=C(C)C(=O)OCC(C(C(CO)O)O)O)O)O)OC1C(C(C(C(O1)COC(=O)C)O)O)O |
SMILES (Isomeric) | CC[C@H](C)C[C@H](C)C[C@H](C)[C@H]([C@@H](C)/C=C(\C)/[C@H]([C@@H](C)/C=C(\C)/[C@H]([C@@H](C)/C=C(\C)/C(=O)OC[C@H]([C@@H]([C@@H](CO)O)O)O)O)O)O[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)COC(=O)C)O)O)O |
InChI | InChI=1S/C42H74O15/c1-12-21(2)13-22(3)14-27(8)40(57-42-39(52)38(51)37(50)33(56-42)20-54-30(11)44)28(9)16-25(6)34(47)23(4)15-24(5)35(48)26(7)17-29(10)41(53)55-19-32(46)36(49)31(45)18-43/h15-17,21-23,26-28,31-40,42-43,45-52H,12-14,18-20H2,1-11H3/b24-15+,25-16+,29-17+/t21-,22-,23-,26-,27-,28-,31+,32+,33+,34-,35+,36+,37+,38-,39-,40+,42-/m0/s1 |
InChI Key | NCIXLNTUPVOTSJ-UTVSEKIBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H74O15 |
Molecular Weight | 819.00 g/mol |
Exact Mass | 818.50277165 g/mol |
Topological Polar Surface Area (TPSA) | 253.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.37% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.04% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.84% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.84% | 85.14% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.65% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.40% | 97.21% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.80% | 95.93% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.44% | 96.47% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.12% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.79% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.99% | 91.11% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.44% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.89% | 89.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.59% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.46% | 99.23% |
CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 85.79% | 87.38% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.88% | 93.56% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.72% | 83.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.76% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.25% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cynara cardunculus |
PubChem | 10509649 |
LOTUS | LTS0175985 |
wikiData | Q105349372 |