(1R,2S,3'S,4S,4'S,5'R,6S,7S,8R,9S,10R,12S,13R,14R,16R)-14-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5',7,9,13-tetramethyl-4'-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',10,16-triol
| Internal ID | bc7aa472-7d84-47b7-b680-1cc9b7c363fd |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (1R,2S,3'S,4S,4'S,5'R,6S,7S,8R,9S,10R,12S,13R,14R,16R)-14-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-5',7,9,13-tetramethyl-4'-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',10,16-triol |
| SMILES (Canonical) | CC1COC2(C(C3C(O2)CC4C3(C(CC5C4CC=C6C5(C(CC(C6)O)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)O)C)C)C(C1OC1C(C(C(C(O1)C)O)O)O)O |
| SMILES (Isomeric) | C[C@@H]1CO[C@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3([C@@H](C[C@H]5[C@@H]4CC=C6[C@@]5([C@@H](C[C@@H](C6)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@@H]([C@H]([C@@H](O9)C)O)O)O)C)O)C)C)[C@H]([C@H]1O[C@H]1[C@@H]([C@@H]([C@H]([C@H](O1)C)O)O)O)O |
| InChI | InChI=1S/C50H80O24/c1-16-14-66-50(43(64)40(16)71-45-38(62)35(59)31(55)18(3)67-45)17(2)30-26(74-50)11-23-22-8-7-20-9-21(52)10-29(48(20,5)24(22)12-28(54)49(23,30)6)70-47-42(73-46-39(63)36(60)32(56)19(4)68-46)41(34(58)27(13-51)69-47)72-44-37(61)33(57)25(53)15-65-44/h7,16-19,21-47,51-64H,8-15H2,1-6H3/t16-,17+,18-,19+,21-,22-,23+,24+,25-,26+,27-,28-,29-,30+,31+,32+,33+,34-,35-,36-,37-,38-,39-,40+,41+,42-,43+,44+,45+,46+,47+,48+,49-,50+/m1/s1 |
| InChI Key | BQVUNOGGHBCCLD-RIULXDDKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H80O24 |
| Molecular Weight | 1065.20 g/mol |
| Exact Mass | 1064.50395341 g/mol |
| Topological Polar Surface Area (TPSA) | 376.00 Ų |
| XlogP | -3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.91% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.24% | 86.33% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.18% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.39% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.11% | 92.94% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.87% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.98% | 94.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.69% | 96.61% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.74% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.46% | 89.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 84.44% | 95.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.21% | 98.95% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.52% | 92.88% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.30% | 97.53% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.67% | 96.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.61% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brodiaea californica |
| PubChem | 163093997 |
| LOTUS | LTS0185185 |
| wikiData | Q104944595 |