(1S,2S,6S,7S,8R,10R,11S,14S,15R,18R,20S)-20-ethoxy-7,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid
Internal ID | 0086002e-a4fc-41bd-aa28-f21b15cafb1b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2S,6S,7S,8R,10R,11S,14S,15R,18R,20S)-20-ethoxy-7,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid |
SMILES (Canonical) | CCOC12CCC3(CO1)C(C2(C)C)CCC4(C3CC=C5C4(CCC6(C5C(C(CC6OC(=O)C(=CC)C)C)C)C(=O)O)C)C |
SMILES (Isomeric) | CCO[C@@]12CC[C@@]3(CO1)[C@H](C2(C)C)CC[C@@]4([C@@H]3CC=C5[C@]4(CC[C@@]6([C@H]5[C@H]([C@@H](C[C@H]6OC(=O)/C(=C\C)/C)C)C)C(=O)O)C)C |
InChI | InChI=1S/C37H56O6/c1-10-22(3)30(38)43-28-20-23(4)24(5)29-25-12-13-27-34(9,33(25,8)16-18-36(28,29)31(39)40)15-14-26-32(6,7)37(41-11-2)19-17-35(26,27)21-42-37/h10,12,23-24,26-29H,11,13-21H2,1-9H3,(H,39,40)/b22-10-/t23-,24+,26+,27+,28-,29+,33-,34-,35-,36-,37+/m1/s1 |
InChI Key | PYAIEKYBXOLIIX-GVDPBLPGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H56O6 |
Molecular Weight | 596.80 g/mol |
Exact Mass | 596.40768950 g/mol |
Topological Polar Surface Area (TPSA) | 82.10 Ų |
XlogP | 7.90 |
There are no found synonyms. |
![2D Structure of (1S,2S,6S,7S,8R,10R,11S,14S,15R,18R,20S)-20-ethoxy-7,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid 2D Structure of (1S,2S,6S,7S,8R,10R,11S,14S,15R,18R,20S)-20-ethoxy-7,8,14,15,19,19-hexamethyl-10-[(Z)-2-methylbut-2-enoyl]oxy-21-oxahexacyclo[18.2.2.01,18.02,15.05,14.06,11]tetracos-4-ene-11-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/9e9dfee0-864a-11ee-8680-1d5a0f54d3d5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.24% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.97% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.72% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.56% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.58% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.69% | 93.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.48% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.32% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 85.20% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.71% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.75% | 89.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 83.63% | 97.93% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 83.55% | 80.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.44% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.27% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.07% | 92.62% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.67% | 82.69% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.04% | 97.21% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.38% | 91.65% |
CHEMBL5028 | O14672 | ADAM10 | 80.22% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.03% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lantana camara |
PubChem | 162874240 |
LOTUS | LTS0075713 |
wikiData | Q104667742 |