(22R,23S)-22-(4-hydroxyphenyl)-23-[(1S,8R,9S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-13-oxahexacyclo[16.3.2.05,21.06,11.012,20.014,19]tricosa-1,3,5(21),6(11),7,9,12(20),14,16,18-decaene-2,4,8,16-tetrol
| Internal ID | bcb1f52f-48ec-47cf-a59b-905ad0889a1f |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | (22R,23S)-22-(4-hydroxyphenyl)-23-[(1S,8R,9S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-13-oxahexacyclo[16.3.2.05,21.06,11.012,20.014,19]tricosa-1,3,5(21),6(11),7,9,12(20),14,16,18-decaene-2,4,8,16-tetrol |
| SMILES (Canonical) | C1=CC(=CC=C1C2C(C3=C4C(C(OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)C7C(C8=C(C=C(C9=C8C1=C(C2=C9C=C(C=C2)O)OC2=CC(=CC7=C21)O)O)O)C1=CC=C(C=C1)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1[C@H]2[C@@H](C3=C4[C@@H]([C@H](OC4=CC(=C3)O)C5=CC=C(C=C5)O)C6=C2C(=CC(=C6)O)O)[C@H]7[C@@H](C8=C(C=C(C9=C8C1=C(C2=C9C=C(C=C2)O)OC2=CC(=CC7=C21)O)O)O)C1=CC=C(C=C1)O)O |
| InChI | InChI=1S/C56H38O12/c57-26-7-1-23(2-8-26)43-46-35(16-30(61)19-38(46)64)51-47-36(17-31(62)20-41(47)67-55(51)25-5-11-28(59)12-6-25)49(43)50-37-18-32(63)21-42-48(37)54-53-45(34-15-29(60)13-14-33(34)56(54)68-42)39(65)22-40(66)52(53)44(50)24-3-9-27(58)10-4-24/h1-22,43-44,49-51,55,57-66H/t43-,44+,49-,50-,51+,55-/m1/s1 |
| InChI Key | MHXQOSXHVFCPEQ-XJTUWPBQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C56H38O12 |
| Molecular Weight | 902.90 g/mol |
| Exact Mass | 902.23632664 g/mol |
| Topological Polar Surface Area (TPSA) | 225.00 Ų |
| XlogP | 10.40 |
| There are no found synonyms. |
![2D Structure of (22R,23S)-22-(4-hydroxyphenyl)-23-[(1S,8R,9S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-13-oxahexacyclo[16.3.2.05,21.06,11.012,20.014,19]tricosa-1,3,5(21),6(11),7,9,12(20),14,16,18-decaene-2,4,8,16-tetrol](https://plantaedb.com/storage/docs/compounds/2023/11/9e631e20-8655-11ee-9a5f-0169aef5c725.jpg "2D Structure of (22R,23S)-22-(4-hydroxyphenyl)-23-[(1S,8R,9S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.02,7.014,17]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-13-oxahexacyclo[16.3.2.05,21.06,11.012,20.014,19]tricosa-1,3,5(21),6(11),7,9,12(20),14,16,18-decaene-2,4,8,16-tetrol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.51% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 98.14% | 98.35% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.56% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.75% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.73% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.14% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.77% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.14% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.48% | 95.56% |
| CHEMBL3194 | P02766 | Transthyretin | 87.56% | 90.71% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 82.08% | 96.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.21% | 95.78% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.83% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vitis amurensis |
| PubChem | 16139607 |
| LOTUS | LTS0126970 |
| wikiData | Q105164369 |