[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 1b4b7b30-a960-4f42-9ade-4e79c26a6268 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=CC=C(C=C3)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C\C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC=C(C=C3)O)O)O)O)O |
InChI | InChI=1S/C21H22O9/c22-13-4-1-12(2-5-13)3-10-17(24)28-11-16-18(25)19(26)20(27)21(30-16)29-15-8-6-14(23)7-9-15/h1-10,16,18-23,25-27H,11H2/b10-3-/t16-,18-,19+,20-,21-/m1/s1 |
InChI Key | DTBYJDROKVCOQC-XCWOQVFSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O9 |
Molecular Weight | 418.40 g/mol |
Exact Mass | 418.12638228 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 1.50 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/9dc24360-84b6-11ee-bc29-63f74c01d3a7.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.29% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.38% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.05% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.94% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.57% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.37% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.14% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 86.98% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.28% | 94.73% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.30% | 89.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.02% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.88% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.24% | 95.89% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.98% | 85.31% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.01% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Breynia vitis-idaea |
Viburnum wrightii |
PubChem | 10002084 |
LOTUS | LTS0126735 |
wikiData | Q104988182 |