[3,4,5-Trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate
Internal ID | 59cc91d2-72d5-426b-9212-dbe83394ba22 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl] 10-[3-[3,5-dihydroxy-6-methyl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6a,6b,9,9,12a-pentamethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OC3C(C(COC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CCC8(C7CC(=C)CC8)C(=O)OC9C(C(C(C(O9)COC1C(C(C(C(O1)CO)O)O)O)O)O)O)C)C)C)O)OC1C(C(C(C(O1)CO)O)O)O)C)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(OC(C2O)OC3C(C(COC3OC4CCC5(C(C4(C)C)CCC6(C5CC=C7C6(CCC8(C7CC(=C)CC8)C(=O)OC9C(C(C(C(O9)COC1C(C(C(C(O1)CO)O)O)O)O)O)O)C)C)C)O)OC1C(C(C(C(O1)CO)O)O)O)C)O)O)O)O |
InChI | InChI=1S/C64H102O30/c1-24-11-16-64(59(82)94-56-48(80)44(76)40(72)32(89-56)23-84-53-45(77)42(74)38(70)30(20-65)87-53)18-17-62(7)27(28(64)19-24)9-10-34-61(6)14-13-35(60(4,5)33(61)12-15-63(34,62)8)90-58-52(50(29(67)22-83-58)91-55-47(79)43(75)39(71)31(21-66)88-55)93-57-49(81)51(37(69)26(3)86-57)92-54-46(78)41(73)36(68)25(2)85-54/h9,25-26,28-58,65-81H,1,10-23H2,2-8H3 |
InChI Key | XFHYYSLBSVCBPW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C64H102O30 |
Molecular Weight | 1351.50 g/mol |
Exact Mass | 1350.64559183 g/mol |
Topological Polar Surface Area (TPSA) | 472.00 Ų |
XlogP | -3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.09% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.78% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.23% | 97.36% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.16% | 97.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.07% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.85% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.73% | 94.45% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.80% | 98.10% |
CHEMBL5028 | O14672 | ADAM10 | 86.15% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.12% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.16% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.67% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.08% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.28% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.25% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.20% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.27% | 99.17% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.91% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Guaiacum officinale |
PubChem | 14355489 |
LOTUS | LTS0138182 |
wikiData | Q105327047 |