[4-[4-[3,5-Dihydroxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]-3,5-dihydroxyphenyl]methyl 4-hydroxy-3,5-dimethoxybenzoate
Internal ID | f3e6c54b-59ea-4dce-945c-bd801375fea9 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [4-[4-[3,5-dihydroxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]-3,5-dihydroxyphenyl]methyl 4-hydroxy-3,5-dimethoxybenzoate |
SMILES (Canonical) | COC1C(C(C(OC1C2=C(C=C(C=C2O)COC(=O)C3=CC(=C(C(=C3)OC)O)OC)O)CO)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)O |
SMILES (Isomeric) | COC1C(C(C(OC1C2=C(C=C(C=C2O)COC(=O)C3=CC(=C(C(=C3)OC)O)OC)O)CO)O)OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)O |
InChI | InChI=1S/C35H48O22/c1-49-16-6-13(7-17(50-2)22(16)41)33(48)52-11-12-4-14(39)21(15(40)5-12)29-32(51-3)31(25(44)19(9-37)53-29)57-35-28(47)30(24(43)20(10-38)55-35)56-34-27(46)26(45)23(42)18(8-36)54-34/h4-7,18-20,23-32,34-47H,8-11H2,1-3H3 |
InChI Key | CPQXELYZEXRCBI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H48O22 |
Molecular Weight | 820.70 g/mol |
Exact Mass | 820.26372315 g/mol |
Topological Polar Surface Area (TPSA) | 343.00 Ų |
XlogP | -3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.18% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.74% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.10% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.86% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.66% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.96% | 94.73% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.52% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.45% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.57% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.51% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.94% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 81.47% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.91% | 92.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.57% | 95.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.01% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Symplocos racemosa |
PubChem | 73059617 |
LOTUS | LTS0169591 |
wikiData | Q104967706 |