5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one
Internal ID | 025fd85f-e2c5-4c5f-9292-73b980ff2da8 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C(=C3C(=C2)OC(=CC3=O)C4=CC=C(C=C4)O)O)OC5C(C(C(CO5)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C(=C3C(=C2)OC(=CC3=O)C4=CC=C(C=C4)O)O)O[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)O |
InChI | InChI=1S/C26H28O14/c1-9-18(30)21(33)23(35)26(37-9)39-16-7-15-17(12(28)6-14(38-15)10-2-4-11(27)5-3-10)20(32)24(16)40-25-22(34)19(31)13(29)8-36-25/h2-7,9,13,18-19,21-23,25-27,29-35H,8H2,1H3/t9-,13+,18-,19-,21+,22+,23+,25-,26-/m0/s1 |
InChI Key | NMVFWKLBYUMROT-GJKPXIFESA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O14 |
Molecular Weight | 564.50 g/mol |
Exact Mass | 564.14790556 g/mol |
Topological Polar Surface Area (TPSA) | 225.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.45% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.82% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.72% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.52% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.29% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.70% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.39% | 85.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.07% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 92.05% | 95.78% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.27% | 83.57% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.99% | 95.64% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.93% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.93% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.46% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.68% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.51% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 83.86% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.08% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.72% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.09% | 99.17% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.09% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Triumfetta rhomboidea |
PubChem | 162969477 |
LOTUS | LTS0082666 |
wikiData | Q105181984 |