(4-Hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl) 2-methylbut-2-enoate
Internal ID | bb5bc22a-2da0-40c5-b180-40d7cb75dbab |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (4-hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl) 2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2(CC3C1C(C4=C(C(CC42)O)C)OC3=O)C |
SMILES (Isomeric) | CC=C(C)C(=O)OC1CC2(CC3C1C(C4=C(C(CC42)O)C)OC3=O)C |
InChI | InChI=1S/C20H26O5/c1-5-9(2)18(22)24-14-8-20(4)7-11-16(14)17(25-19(11)23)15-10(3)13(21)6-12(15)20/h5,11-14,16-17,21H,6-8H2,1-4H3 |
InChI Key | KCZYECYYIPJPKY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O5 |
Molecular Weight | 346.40 g/mol |
Exact Mass | 346.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 1.70 |
There are no found synonyms. |
![2D Structure of (4-Hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl) 2-methylbut-2-enoate 2D Structure of (4-Hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl) 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/99398f10-85ef-11ee-a1fa-37dfd02a0bad.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.61% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.37% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.23% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.81% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.74% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.67% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.84% | 95.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.79% | 99.23% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.40% | 90.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.36% | 97.25% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.19% | 97.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.18% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.94% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.19% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.29% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia pontica |
PubChem | 162924363 |
LOTUS | LTS0085673 |
wikiData | Q105139038 |