20-[(6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranosyl)oxy]-12beta-hydroxydammar-24-en-3beta-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside
Internal ID | a84833c9-1c54-4f8b-9424-544c0ab34f80 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 2-[4,5-dihydroxy-6-(hydroxymethyl)-2-[[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-12-hydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(=CCCC(C)(C1CCC2(C1C(CC3C2(CCC4C3(CCC(C4(C)C)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)C)C)O)C)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)O)O)O)O)C |
SMILES (Isomeric) | CC(=CCC[C@@](C)([C@H]1CC[C@@]2([C@@H]1[C@@H](C[C@H]3[C@]2(CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(C(O6)CO)O)O)O)C)C)O)C)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)O)O)O)O)C |
InChI | InChI=1S/C53H90O22/c1-23(2)10-9-14-53(8,75-47-43(67)39(63)37(61)29(72-47)22-69-45-41(65)34(58)26(57)21-68-45)24-11-16-52(7)33(24)25(56)18-31-50(5)15-13-32(49(3,4)30(50)12-17-51(31,52)6)73-48-44(40(64)36(60)28(20-55)71-48)74-46-42(66)38(62)35(59)27(19-54)70-46/h10,24-48,54-67H,9,11-22H2,1-8H3/t24-,25+,26?,27?,28?,29?,30-,31+,32-,33-,34?,35?,36?,37?,38?,39?,40?,41?,42?,43?,44?,45?,46?,47?,48?,50-,51+,52+,53-/m0/s1 |
InChI Key | NODILNFGTFIURN-NHMFXPJMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C53H90O22 |
Molecular Weight | 1079.30 g/mol |
Exact Mass | 1078.59237449 g/mol |
Topological Polar Surface Area (TPSA) | 357.00 Ų |
XlogP | 0.30 |
Atomic LogP (AlogP) | -1.56 |
H-Bond Acceptor | 22 |
H-Bond Donor | 14 |
Rotatable Bonds | 15 |
C53-H90-O22 |
Ginsenoside Rb2 |
SCHEMBL13988220 |
20-[(6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranosyl)oxy]-12beta-hydroxydammar-24-en-3beta-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside |
NCGC00482516-02 |
A802166 |
2-(hydroxymethyl)-6-[6-(hydroxymethyl)-4,5-bis(oxidanyl)-2-[[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[3,4,5-tris(oxidanyl)-6-[[3,4,5-tris(oxidanyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-hept-5-en-2-yl]-12-oxidanyl-2,3,5,6, |
2-[[4,5-dihydroxy-6-(hydroxymethyl)-2-[[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-12-hydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-2-oxanyl)oxymethyl]-2-oxanyl]oxy]hept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecah |
![2D Structure of 20-[(6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranosyl)oxy]-12beta-hydroxydammar-24-en-3beta-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside 2D Structure of 20-[(6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranosyl)oxy]-12beta-hydroxydammar-24-en-3beta-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside](https://plantaedb.com/storage/docs/compounds/2023/07/97b3c480-26a2-11ee-86c5-075bad496628.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6877 | 68.77% |
Caco-2 | - | 0.9290 | 92.90% |
Blood Brain Barrier | - | 0.5500 | 55.00% |
Human oral bioavailability | - | 0.7857 | 78.57% |
Subcellular localzation | Mitochondria | 0.7251 | 72.51% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8025 | 80.25% |
OATP1B3 inhibitior | + | 0.8189 | 81.89% |
MATE1 inhibitior | - | 0.9612 | 96.12% |
OCT2 inhibitior | - | 0.6000 | 60.00% |
BSEP inhibitior | + | 0.8720 | 87.20% |
P-glycoprotein inhibitior | + | 0.7537 | 75.37% |
P-glycoprotein substrate | - | 0.6505 | 65.05% |
CYP3A4 substrate | + | 0.7360 | 73.60% |
CYP2C9 substrate | - | 0.8025 | 80.25% |
CYP2D6 substrate | - | 0.8264 | 82.64% |
CYP3A4 inhibition | - | 0.9502 | 95.02% |
CYP2C9 inhibition | - | 0.8671 | 86.71% |
CYP2C19 inhibition | - | 0.9036 | 90.36% |
CYP2D6 inhibition | - | 0.9380 | 93.80% |
CYP1A2 inhibition | - | 0.9057 | 90.57% |
CYP2C8 inhibition | + | 0.7142 | 71.42% |
CYP inhibitory promiscuity | - | 0.9413 | 94.13% |
UGT catelyzed | - | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.6474 | 64.74% |
Eye corrosion | - | 0.9907 | 99.07% |
Eye irritation | - | 0.9019 | 90.19% |
Skin irritation | - | 0.5956 | 59.56% |
Skin corrosion | - | 0.9488 | 94.88% |
Ames mutagenesis | - | 0.6600 | 66.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8679 | 86.79% |
Micronuclear | - | 0.8800 | 88.00% |
Hepatotoxicity | + | 0.7071 | 70.71% |
skin sensitisation | - | 0.8991 | 89.91% |
Respiratory toxicity | + | 0.5333 | 53.33% |
Reproductive toxicity | + | 0.8889 | 88.89% |
Mitochondrial toxicity | - | 0.5875 | 58.75% |
Nephrotoxicity | - | 0.7949 | 79.49% |
Acute Oral Toxicity (c) | I | 0.5677 | 56.77% |
Estrogen receptor binding | + | 0.7951 | 79.51% |
Androgen receptor binding | + | 0.7471 | 74.71% |
Thyroid receptor binding | + | 0.5507 | 55.07% |
Glucocorticoid receptor binding | + | 0.7510 | 75.10% |
Aromatase binding | + | 0.6572 | 65.72% |
PPAR gamma | + | 0.7952 | 79.52% |
Honey bee toxicity | - | 0.5468 | 54.68% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
Fish aquatic toxicity | + | 0.9172 | 91.72% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3038455 | P54646 | AMPK alpha2/beta1/gamma1 |
16.8 nM |
EC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.42% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.17% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.04% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.21% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.35% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.71% | 92.94% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.15% | 95.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.41% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.25% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.95% | 97.36% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.52% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.26% | 95.89% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 86.62% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.17% | 94.75% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.78% | 95.58% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.80% | 94.45% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.79% | 97.14% |
CHEMBL2581 | P07339 | Cathepsin D | 84.14% | 98.95% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.96% | 96.90% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.58% | 97.79% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.30% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.99% | 92.62% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.96% | 95.83% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.89% | 82.69% |
CHEMBL5028 | O14672 | ADAM10 | 82.84% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.25% | 89.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.49% | 92.88% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.48% | 95.71% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.99% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Panax ginseng |
Panax japonicus |
Panax notoginseng |
Panax quinquefolius |