[(2R,3R)-5,7-dihydroxy-8-[(1R,2R)-2-(3,4,5-trihydroxybenzoyl)oxy-3-(2,4,6-trihydroxyphenyl)-1-(3,4,5-trihydroxyphenyl)propyl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate
Internal ID | 26f4b9de-0f93-4ea4-9f62-a15c22a6acba |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins > Catechin gallates |
IUPAC Name | [(2R,3R)-5,7-dihydroxy-8-[(1R,2R)-2-(3,4,5-trihydroxybenzoyl)oxy-3-(2,4,6-trihydroxyphenyl)-1-(3,4,5-trihydroxyphenyl)propyl]-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC(=C2C(C3=CC(=C(C(=C3)O)O)O)C(CC4=C(C=C(C=C4O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
SMILES (Isomeric) | C1[C@H]([C@H](OC2=C1C(=CC(=C2[C@@H](C3=CC(=C(C(=C3)O)O)O)[C@@H](CC4=C(C=C(C=C4O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
InChI | InChI=1S/C44H36O22/c45-18-9-21(46)19(22(47)10-18)11-33(64-43(62)16-5-29(54)39(60)30(55)6-16)35(14-1-25(50)37(58)26(51)2-14)36-24(49)13-23(48)20-12-34(65-44(63)17-7-31(56)40(61)32(57)8-17)41(66-42(20)36)15-3-27(52)38(59)28(53)4-15/h1-10,13,33-35,41,45-61H,11-12H2/t33-,34-,35+,41-/m1/s1 |
InChI Key | SKYSKYXPHIEIOH-HGFNXMTOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H36O22 |
Molecular Weight | 916.70 g/mol |
Exact Mass | 916.16982277 g/mol |
Topological Polar Surface Area (TPSA) | 406.00 Ų |
XlogP | 4.30 |
SCHEMBL5087872 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.43% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.53% | 99.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.21% | 95.17% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.13% | 97.93% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 93.00% | 96.37% |
CHEMBL2581 | P07339 | Cathepsin D | 92.96% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.17% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.42% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.98% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 90.54% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 89.83% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.61% | 86.33% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 89.59% | 92.98% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.15% | 90.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.80% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.51% | 95.89% |
CHEMBL236 | P41143 | Delta opioid receptor | 84.09% | 99.35% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.88% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.73% | 92.62% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.11% | 96.12% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.90% | 94.73% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.57% | 98.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.11% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia sinensis |
PubChem | 467310 |
LOTUS | LTS0167879 |
wikiData | Q105255144 |