6-amino-2-[[2-[[13-[3-(diaminomethylideneamino)propyl]-22-(2-methylpropyl)-12,15,18,21,24-pentaoxo-25-[(5-oxopyrrolidine-2-carbonyl)amino]-19,26-di(propan-2-yl)-3,5,7,11,14,17,20,23-octazapentacyclo[14.13.2.12,27.15,8.04,30]tritriaconta-1,4(30),6,8(33),27(32),28-hexaene-10-carbonyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid
| Internal ID | 66b216cb-8c61-4f35-8d79-3c19feb2e49c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 6-amino-2-[[2-[[13-[3-(diaminomethylideneamino)propyl]-22-(2-methylpropyl)-12,15,18,21,24-pentaoxo-25-[(5-oxopyrrolidine-2-carbonyl)amino]-19,26-di(propan-2-yl)-3,5,7,11,14,17,20,23-octazapentacyclo[14.13.2.12,27.15,8.04,30]tritriaconta-1,4(30),6,8(33),27(32),28-hexaene-10-carbonyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
| SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)N1)NC(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)C(NC2=O)CCCN=C(N)N)C(=O)NC(CC7=CN=CN7)C(=O)NC(CCCCN)C(=O)O)N=C6)C(C)C |
| SMILES (Isomeric) | CC(C)CC1C(=O)NC(C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)N1)NC(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)C(NC2=O)CCCN=C(N)N)C(=O)NC(CC7=CN=CN7)C(=O)NC(CCCCN)C(=O)O)N=C6)C(C)C |
| InChI | InChI=1S/C57H82N18O11/c1-27(2)18-39-53(82)73-45(29(5)6)54(83)72-42-22-34-33-13-12-30(44(28(3)4)46(55(84)71-39)74-49(78)36-14-15-43(76)65-36)19-38(33)66-47(34)75-24-32(64-26-75)21-41(69-48(77)35(67-52(42)81)11-9-17-62-57(59)60)51(80)70-40(20-31-23-61-25-63-31)50(79)68-37(56(85)86)10-7-8-16-58/h12-13,19,23-29,35-37,39-42,44-46,66H,7-11,14-18,20-22,58H2,1-6H3,(H,61,63)(H,65,76)(H,67,81)(H,68,79)(H,69,77)(H,70,80)(H,71,84)(H,72,83)(H,73,82)(H,74,78)(H,85,86)(H4,59,60,62) |
| InChI Key | HZBNMZKBKVMAAO-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C57H82N18O11 |
| Molecular Weight | 1195.40 g/mol |
| Exact Mass | 1194.64104550 g/mol |
| Topological Polar Surface Area (TPSA) | 452.00 Ų |
| XlogP | -2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.99% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.92% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.70% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.62% | 94.45% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 99.25% | 97.23% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.03% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.61% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.97% | 97.09% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.71% | 88.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.60% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.16% | 99.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.47% | 90.08% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.02% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.01% | 90.71% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 95.77% | 91.38% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.76% | 97.64% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.75% | 98.75% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.75% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.83% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.90% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.75% | 95.56% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 92.59% | 97.31% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 92.19% | 98.94% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.95% | 95.58% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.78% | 100.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.71% | 97.53% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.54% | 85.14% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 90.43% | 82.86% |
| CHEMBL1628481 | P35414 | Apelin receptor | 90.14% | 97.89% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.04% | 95.56% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 89.97% | 96.67% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.81% | 96.47% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 89.22% | 95.38% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 89.08% | 90.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.51% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.89% | 93.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.73% | 98.59% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 87.07% | 80.71% |
| CHEMBL5028 | O14672 | ADAM10 | 87.06% | 97.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.13% | 96.90% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 85.53% | 88.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.50% | 99.23% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 84.97% | 88.42% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.56% | 93.10% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 84.49% | 85.83% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.48% | 96.11% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.94% | 96.25% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.61% | 90.20% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 83.51% | 87.16% |
| CHEMBL236 | P41143 | Delta opioid receptor | 83.31% | 99.35% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.84% | 97.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.80% | 82.69% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 82.52% | 100.00% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 82.42% | 95.12% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.33% | 91.49% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 81.68% | 99.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.49% | 93.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.56% | 97.14% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.32% | 91.71% |
| CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 80.27% | 97.15% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 80.22% | 99.52% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.14% | 100.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 80.07% | 98.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Celosia argentea |
| PubChem | 76185975 |
| LOTUS | LTS0234499 |
| wikiData | Q105035591 |