2-[3,5-dihydroxy-4-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-5,7-dihydroxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one
Internal ID | 1443a5d2-d090-434e-9612-c20548be72d2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-[3,5-dihydroxy-4-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-5,7-dihydroxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(C=C(C=C2O)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)OC5C(C(C(C(O5)C)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC2=C(C=C(C=C2O)C3=C(C(=O)C4=C(C=C(C=C4O3)O)O)O[C@H]5[C@H]([C@@H]([C@H]([C@H](O5)C)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H30O16/c1-7-16(32)19(35)21(37)26(39-7)42-24-12(30)3-9(4-13(24)31)23-25(43-27-22(38)20(36)17(33)8(2)40-27)18(34)15-11(29)5-10(28)6-14(15)41-23/h3-8,16-17,19-22,26-33,35-38H,1-2H3/t7-,8-,16+,17+,19-,20-,21+,22+,26+,27+/m1/s1 |
InChI Key | FILUBISJJZTQMB-XCZNUEGDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O16 |
Molecular Weight | 610.50 g/mol |
Exact Mass | 610.15338487 g/mol |
Topological Polar Surface Area (TPSA) | 266.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of 2-[3,5-dihydroxy-4-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-5,7-dihydroxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one 2D Structure of 2-[3,5-dihydroxy-4-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]-5,7-dihydroxy-3-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/95a06b00-856d-11ee-9899-8def8e4b60b6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.22% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.57% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.98% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 94.96% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.71% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.15% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.59% | 95.64% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.30% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 88.13% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.42% | 99.17% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.15% | 91.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.69% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.59% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.58% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.84% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.15% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.94% | 99.15% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.47% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrsine seguinii |
PubChem | 163004405 |
LOTUS | LTS0232320 |
wikiData | Q104995771 |