(9,10,15-Trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl)methyl acetate
Internal ID | 9c307a48-576b-491d-a701-cce557ff7f53 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (9,10,15-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl)methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCC(C23C1C(C(C45C2CCC(C4)C(=C)C5=O)(OC3)O)O)O)C |
SMILES (Isomeric) | CC(=O)OCC1(CCC(C23C1C(C(C45C2CCC(C4)C(=C)C5=O)(OC3)O)O)O)C |
InChI | InChI=1S/C22H30O7/c1-11-13-4-5-14-20-10-29-22(27,21(14,8-13)17(11)25)18(26)16(20)19(3,7-6-15(20)24)9-28-12(2)23/h13-16,18,24,26-27H,1,4-10H2,2-3H3 |
InChI Key | UDOQTYDWKGQXFY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H30O7 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.02% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.62% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.34% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.07% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.62% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.19% | 98.95% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.44% | 96.38% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.94% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.58% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.38% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.32% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.50% | 91.19% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.41% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.33% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.24% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.64% | 89.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.34% | 94.33% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.87% | 97.28% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.73% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.65% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.38% | 85.14% |
CHEMBL5028 | O14672 | ADAM10 | 80.29% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon effusus |
Isodon japonicus |
Isodon xerophilus |
Salvia ballotiflora |
PubChem | 75052824 |
LOTUS | LTS0142607 |
wikiData | Q103813555 |