3beta-[2-O-(alpha-L-Rhamnopyranosyl)-4-O-[4-O-(beta-D-glucopyranosyl)-beta-D-glucopyranosyl]-alpha-L-arabinopyranosyloxy]-23-hydroxylupan-20(29)-en-28-oic acid 6-O-[4-O-(alpha-L-rhamnopyranosyl)-beta-D-glucopyranosyl]-beta-D-glucopyranosyl ester
Internal ID | 252ae16e-5330-4c6e-8eb5-59341ad3d782 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] (1R,3aS,5aR,5bR,7aR,8R,9S,11aR,11bR,13aR,13bR)-9-[(2S,3R,4S,5S)-5-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-8-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(C4C6CCC7C8(CCC(C(C8CCC7(C6(CC5)C)C)(C)CO)OC9C(C(C(CO9)OC1C(C(C(C(O1)CO)OC1C(C(C(C(O1)CO)O)O)O)O)O)O)OC1C(C(C(C(O1)C)O)O)O)C)C(=C)C)O)O)O)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)OC[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)OC(=O)[C@]45CC[C@H]([C@@H]4[C@H]6CC[C@@H]7[C@]8(CC[C@@H]([C@@]([C@@H]8CC[C@]7([C@@]6(CC5)C)C)(C)CO)O[C@H]9[C@@H]([C@H]([C@H](CO9)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)C)C(=C)C)O)O)O)CO)O)O)O |
InChI | InChI=1S/C71H116O36/c1-25(2)28-11-16-71(66(93)107-64-53(90)47(84)42(79)33(101-64)22-94-59-54(91)48(85)56(31(20-73)99-59)104-60-50(87)44(81)39(76)26(3)96-60)18-17-69(7)29(38(28)71)9-10-36-67(5)14-13-37(68(6,24-75)35(67)12-15-70(36,69)8)103-65-58(106-61-51(88)45(82)40(77)27(4)97-61)43(80)34(23-95-65)102-62-55(92)49(86)57(32(21-74)100-62)105-63-52(89)46(83)41(78)30(19-72)98-63/h26-65,72-92H,1,9-24H2,2-8H3/t26-,27-,28-,29+,30+,31+,32+,33+,34-,35+,36+,37-,38+,39-,40-,41+,42+,43-,44+,45+,46-,47-,48+,49+,50+,51+,52+,53+,54+,55+,56+,57+,58+,59+,60-,61-,62-,63-,64-,65-,67-,68-,69+,70+,71-/m0/s1 |
InChI Key | NWWQLXKEDLLKBI-JXJHENQESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C71H116O36 |
Molecular Weight | 1545.70 g/mol |
Exact Mass | 1544.7246300 g/mol |
Topological Polar Surface Area (TPSA) | 571.00 Ų |
XlogP | -5.00 |
Atomic LogP (AlogP) | -7.04 |
H-Bond Acceptor | 36 |
H-Bond Donor | 21 |
Rotatable Bonds | 20 |
DTXSID201098020 |
366814-44-0 |
3beta-[2-O-(alpha-L-Rhamnopyranosyl)-4-O-[4-O-(beta-D-glucopyranosyl)-beta-D-glucopyranosyl]-alpha-L-arabinopyranosyloxy]-23-hydroxylupan-20(29)-en-28-oic acid 6-O-[4-O-(alpha-L-rhamnopyranosyl)-beta-D-glucopyranosyl]-beta-D-glucopyranosyl ester |
O-6-Deoxy-alpha-L-mannopyranosyl-(1-->4)-O-beta-D-glucopyranosyl-(1-->6)-beta-D-glucopyranosyl (3beta,4alpha)-3-[(O-6-deoxy-alpha-L-mannopyranosyl-(1-->2)-O-[O-beta-D-glucopyranosyl-(1-->4)-beta-D-glucopyranosyl-(1-->4)]-alpha-L-arabinopyranosyl)oxy]-23-hydroxylup-20(29)-en-28-oate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.6500 | 65.00% |
Caco-2 | - | 0.8682 | 86.82% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.8000 | 80.00% |
Subcellular localzation | Mitochondria | 0.7713 | 77.13% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8702 | 87.02% |
OATP1B3 inhibitior | + | 0.8155 | 81.55% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.7526 | 75.26% |
BSEP inhibitior | + | 0.9505 | 95.05% |
P-glycoprotein inhibitior | + | 0.7437 | 74.37% |
P-glycoprotein substrate | + | 0.6491 | 64.91% |
CYP3A4 substrate | + | 0.7503 | 75.03% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8587 | 85.87% |
CYP3A4 inhibition | - | 0.9527 | 95.27% |
CYP2C9 inhibition | - | 0.9059 | 90.59% |
CYP2C19 inhibition | - | 0.8980 | 89.80% |
CYP2D6 inhibition | - | 0.9476 | 94.76% |
CYP1A2 inhibition | - | 0.8816 | 88.16% |
CYP2C8 inhibition | + | 0.7849 | 78.49% |
CYP inhibitory promiscuity | - | 0.9276 | 92.76% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 1.0000 | 100.00% |
Carcinogenicity (trinary) | Non-required | 0.6833 | 68.33% |
Eye corrosion | - | 0.9899 | 98.99% |
Eye irritation | - | 0.8976 | 89.76% |
Skin irritation | - | 0.5278 | 52.78% |
Skin corrosion | - | 0.9457 | 94.57% |
Ames mutagenesis | - | 0.5800 | 58.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7818 | 78.18% |
Micronuclear | - | 0.9100 | 91.00% |
Hepatotoxicity | - | 0.7625 | 76.25% |
skin sensitisation | - | 0.9142 | 91.42% |
Respiratory toxicity | + | 0.5667 | 56.67% |
Reproductive toxicity | + | 0.8111 | 81.11% |
Mitochondrial toxicity | - | 0.5625 | 56.25% |
Nephrotoxicity | - | 0.9015 | 90.15% |
Acute Oral Toxicity (c) | I | 0.4430 | 44.30% |
Estrogen receptor binding | + | 0.7672 | 76.72% |
Androgen receptor binding | + | 0.7635 | 76.35% |
Thyroid receptor binding | + | 0.6322 | 63.22% |
Glucocorticoid receptor binding | + | 0.7738 | 77.38% |
Aromatase binding | + | 0.6744 | 67.44% |
PPAR gamma | + | 0.8196 | 81.96% |
Honey bee toxicity | - | 0.5838 | 58.38% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
Fish aquatic toxicity | + | 0.9729 | 97.29% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.88% | 97.36% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.84% | 91.11% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.91% | 97.93% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 92.18% | 91.24% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.53% | 96.09% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 91.47% | 97.33% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.09% | 92.86% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.44% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.17% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 90.13% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.65% | 86.33% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.32% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.81% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.77% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.49% | 95.50% |
CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 86.67% | 91.83% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 86.45% | 97.86% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.23% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.72% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.60% | 92.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.87% | 94.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.80% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.69% | 91.19% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.46% | 94.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.44% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.38% | 97.50% |
CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 84.08% | 85.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.58% | 94.45% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.53% | 89.05% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.04% | 100.00% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 82.95% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.94% | 96.77% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.89% | 97.53% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.72% | 92.98% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.54% | 99.17% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.47% | 96.90% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.15% | 99.17% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.75% | 93.10% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.58% | 93.04% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.35% | 95.83% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.19% | 96.38% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.72% | 96.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.60% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.11% | 96.43% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.05% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pulsatilla chinensis |