3,8-Dihydroxyspiro[2,3-dihydronaphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1-one
Internal ID | 9a4de839-80f2-4b48-bcc1-a9dfee5ea870 |
Taxonomy | Benzenoids > Tetralins |
IUPAC Name | 3,8-dihydroxyspiro[2,3-dihydronaphthalene-4,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1-one |
SMILES (Canonical) | C1C(C2(C3=C(C1=O)C(=CC=C3)O)OC4=CC=CC5=C4C(=CC=C5)O2)O |
SMILES (Isomeric) | C1C(C2(C3=C(C1=O)C(=CC=C3)O)OC4=CC=CC5=C4C(=CC=C5)O2)O |
InChI | InChI=1S/C20H14O5/c21-13-7-3-6-12-19(13)14(22)10-17(23)20(12)24-15-8-1-4-11-5-2-9-16(25-20)18(11)15/h1-9,17,21,23H,10H2 |
InChI Key | IDPDCBWKAQHWIS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H14O5 |
Molecular Weight | 334.30 g/mol |
Exact Mass | 334.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.24% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.99% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.66% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.25% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.95% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.04% | 94.45% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 87.95% | 85.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.35% | 94.00% |
CHEMBL240 | Q12809 | HERG | 84.90% | 89.76% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.36% | 91.49% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.52% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.12% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.50% | 99.15% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.69% | 94.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.63% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jatropha curcas |
PubChem | 72771785 |
LOTUS | LTS0104160 |
wikiData | Q105111446 |