5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | f223bc4e-f03b-4cf4-9738-3e1d8df2612e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C=C4C(=C3O)C(=O)C=C(O4)C5=CC=C(C=C5)O)OC)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(C=C4C(=C3O)C(=O)C=C(O4)C5=CC=C(C=C5)O)OC)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O15/c1-10-19(31)22(34)24(36)27(40-10)39-9-17-20(32)23(35)25(37)28(42-17)43-26-16(38-2)8-15-18(21(26)33)13(30)7-14(41-15)11-3-5-12(29)6-4-11/h3-8,10,17,19-20,22-25,27-29,31-37H,9H2,1-2H3 |
InChI Key | IAXGLXFIQSEJPB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O15 |
Molecular Weight | 608.50 g/mol |
Exact Mass | 608.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -0.80 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one 2D Structure of 5-Hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/942d16c0-855e-11ee-8d3c-e1bef5722263.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.05% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.87% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.87% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.70% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.51% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.51% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.71% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.03% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.94% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 85.73% | 90.71% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.44% | 95.78% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.22% | 95.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.43% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.23% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.69% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.14% | 97.36% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.11% | 94.03% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.12% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Pterogyne nitens |
PubChem | 74343444 |
LOTUS | LTS0118582 |
wikiData | Q105036333 |