[7-(2-phenylacetyl)oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,3-dihydroxy-2-methylbutanoate
Internal ID | 7637014b-3124-4c52-8287-1e894dfb92c6 |
Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
IUPAC Name | [7-(2-phenylacetyl)oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,3-dihydroxy-2-methylbutanoate |
SMILES (Canonical) | CC(C(C)(C(=O)OCC1CCN2C1C(CC2)OC(=O)CC3=CC=CC=C3)O)O |
SMILES (Isomeric) | CC(C(C)(C(=O)OCC1CCN2C1C(CC2)OC(=O)CC3=CC=CC=C3)O)O |
InChI | InChI=1S/C21H29NO6/c1-14(23)21(2,26)20(25)27-13-16-8-10-22-11-9-17(19(16)22)28-18(24)12-15-6-4-3-5-7-15/h3-7,14,16-17,19,23,26H,8-13H2,1-2H3 |
InChI Key | ZIZWTEQHLVZFMT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H29NO6 |
Molecular Weight | 391.50 g/mol |
Exact Mass | 391.19948764 g/mol |
Topological Polar Surface Area (TPSA) | 96.30 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of [7-(2-phenylacetyl)oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,3-dihydroxy-2-methylbutanoate 2D Structure of [7-(2-phenylacetyl)oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 2,3-dihydroxy-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/939759b0-860a-11ee-8a7e-fd9e5a4601ce.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.34% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.88% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.08% | 85.14% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.62% | 83.82% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.96% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.08% | 95.56% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 91.85% | 94.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.19% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.53% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.82% | 90.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.72% | 94.62% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.79% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.50% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 85.29% | 97.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.86% | 97.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.97% | 86.33% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.81% | 93.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.68% | 91.11% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.97% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.31% | 95.89% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.21% | 98.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.42% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea hederifolia |
PubChem | 74202898 |
LOTUS | LTS0237852 |
wikiData | Q105377703 |