5,7,11-trihydroxy-9-(hydroxymethyl)-4,4,11b-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-6-one
Internal ID | 130ea072-8460-468b-9786-db0627934b68 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 5,7,11-trihydroxy-9-(hydroxymethyl)-4,4,11b-trimethyl-2,3-dihydro-1H-naphtho[2,1-f][1]benzofuran-6-one |
SMILES (Canonical) | CC1(CCCC2(C1=C(C(=O)C3=C2C(=C4C(=C3O)C=C(O4)CO)O)O)C)C |
SMILES (Isomeric) | CC1(CCCC2(C1=C(C(=O)C3=C2C(=C4C(=C3O)C=C(O4)CO)O)O)C)C |
InChI | InChI=1S/C20H22O6/c1-19(2)5-4-6-20(3)12-11(14(23)16(25)18(19)20)13(22)10-7-9(8-21)26-17(10)15(12)24/h7,21-22,24-25H,4-6,8H2,1-3H3 |
InChI Key | XFWXVVIPMSCASB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O6 |
Molecular Weight | 358.40 g/mol |
Exact Mass | 358.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 111.00 Ų |
XlogP | 3.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.73% | 93.99% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.58% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.32% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.22% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.91% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.13% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.09% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.61% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.85% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.54% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.66% | 86.33% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 83.64% | 95.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.78% | 95.89% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.60% | 90.08% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.03% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Teucrium polium |
PubChem | 75970984 |
LOTUS | LTS0037647 |
wikiData | Q105327349 |