[4-formyl-4a-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,6,7,7a-tetrahydro-1H-cyclopenta[c]pyran-6-yl] 3-phenylprop-2-enoate
Internal ID | 4661c9f8-3138-4bad-882e-3fdd8cb56a69 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [4-formyl-4a-hydroxy-7-methyl-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5,6,7,7a-tetrahydro-1H-cyclopenta[c]pyran-6-yl] 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1C(CC2(C1C(OC=C2C=O)OC3C(C(C(C(O3)CO)O)O)O)O)OC(=O)C=CC4=CC=CC=C4 |
SMILES (Isomeric) | CC1C(CC2(C1C(OC=C2C=O)OC3C(C(C(C(O3)CO)O)O)O)O)OC(=O)C=CC4=CC=CC=C4 |
InChI | InChI=1S/C25H30O11/c1-13-16(34-18(28)8-7-14-5-3-2-4-6-14)9-25(32)15(10-26)12-33-23(19(13)25)36-24-22(31)21(30)20(29)17(11-27)35-24/h2-8,10,12-13,16-17,19-24,27,29-32H,9,11H2,1H3 |
InChI Key | OGMPPLUGEMUXPE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O11 |
Molecular Weight | 506.50 g/mol |
Exact Mass | 506.17881177 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.42% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.91% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.69% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.91% | 90.17% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 93.38% | 94.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.25% | 96.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 92.54% | 94.23% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.54% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 89.43% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 88.52% | 97.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.19% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.45% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.04% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.11% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Campsis grandiflora |
Tecoma capensis |
PubChem | 78410085 |
LOTUS | LTS0161635 |
wikiData | Q105191714 |