(1R,13S,15R,18R)-15-Methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-ol
Internal ID | 58f87f7b-d743-4f23-aabe-5b6c62882e7f |
Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Crinine- and Haemanthamine-type amaryllidaceae alkaloids |
IUPAC Name | (1R,13S,15R,18R)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-ol |
SMILES (Canonical) | COC1CC2C3(C=C1)C(CN2CC4=CC5=C(C=C34)OCO5)O |
SMILES (Isomeric) | CO[C@@H]1C[C@H]2[C@]3(C=C1)[C@H](CN2CC4=CC5=C(C=C34)OCO5)O |
InChI | InChI=1S/C17H19NO4/c1-20-11-2-3-17-12-6-14-13(21-9-22-14)4-10(12)7-18(8-16(17)19)15(17)5-11/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15-,16-,17+/m0/s1 |
InChI Key | YGPRSGKVLATIHT-GNCDUGFZSA-N |
Popularity | 12 references in papers |
Molecular Formula | C17H19NO4 |
Molecular Weight | 301.34 g/mol |
Exact Mass | 301.13140809 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 1.30 |
CHEMBL1221865 |
(1R,13S,15R,18R)-15-Methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-ol |
![2D Structure of (1R,13S,15R,18R)-15-Methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-ol 2D Structure of (1R,13S,15R,18R)-15-Methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-ol](https://plantaedb.com/storage/docs/compounds/2023/07/91bbd280-21f2-11ee-8a6a-c12c0addf181.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
6.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.01% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.41% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.34% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.21% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.73% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.25% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.08% | 92.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.41% | 92.94% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.66% | 80.96% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.39% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.12% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.03% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.01% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.67% | 85.14% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 81.56% | 82.67% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.89% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amaryllidaceae |
Angelica pubescens |
Angelica sinensis |
Artemisia capillaris |
Crinum asiaticum |
Crinum bulbispermum |
PubChem | 12096833 |
NPASS | NPC82533 |
ChEMBL | CHEMBL1221865 |