9,19-Cyclolanostan-3-one, 26-hydroxy-24-methylene-, (25R)-
Internal ID | d413146d-c0c9-4cfc-9ae1-d40da82a8526 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | (1S,3R,8R,11S,12S,15R,16R)-15-[(2R,6R)-7-hydroxy-6-methyl-5-methylideneheptan-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-one |
SMILES (Canonical) | CC(CCC(=C)C(C)CO)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(=O)C5(C)C)C)C |
SMILES (Isomeric) | C[C@H](CCC(=C)[C@@H](C)CO)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CCC(=O)C5(C)C)C)C |
InChI | InChI=1S/C31H50O2/c1-20(22(3)18-32)8-9-21(2)23-12-14-29(7)25-11-10-24-27(4,5)26(33)13-15-30(24)19-31(25,30)17-16-28(23,29)6/h21-25,32H,1,8-19H2,2-7H3/t21-,22+,23-,24+,25+,28-,29+,30-,31+/m1/s1 |
InChI Key | OKILVWSNJYSCMZ-XZTCGNEDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H50O2 |
Molecular Weight | 454.70 g/mol |
Exact Mass | 454.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.80 |
9,19-Cyclolanostan-3-one, 26-hydroxy-24-methylene-, (25R)- |
232266-06-7 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.64% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.06% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.75% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.53% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.84% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.25% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.24% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.60% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.59% | 97.09% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.24% | 93.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.65% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.07% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.93% | 83.82% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.37% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.26% | 96.47% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.41% | 90.08% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.71% | 96.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.40% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mangifera indica |
Xanthoceras sorbifolium |
PubChem | 162891806 |
LOTUS | LTS0209556 |
wikiData | Q105193572 |