9,19-Cyclolanost-24-ene-3,26-diol, (3beta)-
| Internal ID | d722e6e6-cab9-48cb-a999-0e00682b8e64 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
| IUPAC Name | (1S,3R,6S,8R,11S,12S,15R,16R)-15-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
| SMILES (Canonical) | CC(CCC=C(C)CO)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
| SMILES (Isomeric) | C[C@H](CC/C=C(\C)/CO)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@H]2CC[C@@H]5[C@]3(C4)CC[C@@H](C5(C)C)O)C)C |
| InChI | InChI=1S/C30H50O2/c1-20(18-31)8-7-9-21(2)22-12-14-28(6)24-11-10-23-26(3,4)25(32)13-15-29(23)19-30(24,29)17-16-27(22,28)5/h8,21-25,31-32H,7,9-19H2,1-6H3/b20-8+/t21-,22-,23+,24+,25+,27-,28+,29-,30+/m1/s1 |
| InChI Key | KHRXLABAHCIXIJ-VGMYXFKYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.70 g/mol |
| Exact Mass | 442.381080833 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 8.50 |
| UNII-9L6D9RUX7B |
| Cycloart-24-en-3beta,26-diol |
| Cycloart-24-ene-3beta,26-diol |
| (3beta)-9,19-Cyclolanost-24-ene-3,26-diol |
| 9,19-Cyclo-9beta-lanost-24-ene-3beta,26-diol |
| 9,19-Cyclolanost-24-ene-3,26-diol, (3beta)- |
| 4624-31-1 |
| Mangiferadiol |
| DTXSID701317695 |
| CYCLOART-24-EN-3.BETA.,26-DIOL |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.59% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.69% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.67% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.67% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.42% | 96.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.46% | 95.58% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.58% | 94.45% |
| CHEMBL233 | P35372 | Mu opioid receptor | 89.32% | 97.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.16% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.97% | 96.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.35% | 100.00% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 87.12% | 95.92% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.50% | 94.75% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.17% | 93.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 85.71% | 98.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.34% | 95.50% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.99% | 92.86% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 84.27% | 96.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.07% | 100.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.83% | 98.75% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.51% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.06% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.00% | 100.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.40% | 99.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.30% | 90.08% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.86% | 82.69% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.68% | 97.79% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.53% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 81.36% | 96.61% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 80.87% | 94.78% |
| CHEMBL268 | P43235 | Cathepsin K | 80.40% | 96.85% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mangifera indica |
| PubChem | 134694294 |
| LOTUS | LTS0237208 |
| wikiData | Q105141306 |