[5-hydroxy-2-[6-[[17-(1-hydroxyethyl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(sulfooxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-6-methyloxan-3-yl] acetate
| Internal ID | a00d8aa6-f927-4c94-a62a-158b14de519e |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [5-hydroxy-2-[6-[[17-(1-hydroxyethyl)-10,13-dimethyl-16-[3,4,5-trihydroxy-6-(sulfooxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-methoxy-2-methyloxan-3-yl]oxy-4-methoxy-6-methyloxan-3-yl] acetate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC(C6C(C)O)OC7C(C(C(C(O7)COS(=O)(=O)O)O)O)O)C)C)C)OC(=O)C)OC)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC(C6C(C)O)OC7C(C(C(C(O7)COS(=O)(=O)O)O)O)O)C)C)C)OC(=O)C)OC)O |
| InChI | InChI=1S/C43H70O19S/c1-19(44)32-28(60-40-36(49)35(48)34(47)30(61-40)18-55-63(50,51)52)16-27-25-10-9-23-15-24(11-13-42(23,5)26(25)12-14-43(27,32)6)59-31-17-29(53-7)37(21(3)56-31)62-41-39(58-22(4)45)38(54-8)33(46)20(2)57-41/h9,19-21,24-41,44,46-49H,10-18H2,1-8H3,(H,50,51,52) |
| InChI Key | CAKCYMTUTWWVMM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C43H70O19S |
| Molecular Weight | 923.10 g/mol |
| Exact Mass | 922.42320117 g/mol |
| Topological Polar Surface Area (TPSA) | 273.00 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.33% | 96.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 97.54% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.00% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 96.52% | 95.93% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.09% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.71% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.38% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.30% | 91.11% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 93.87% | 85.31% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.02% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.61% | 89.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.99% | 92.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.06% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.11% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.77% | 93.56% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.33% | 95.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.31% | 94.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.13% | 91.19% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.07% | 94.08% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.74% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.02% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.86% | 100.00% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 83.60% | 92.78% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.50% | 94.33% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.37% | 98.59% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.03% | 97.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.55% | 86.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.51% | 96.38% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.20% | 94.97% |
| CHEMBL5028 | O14672 | ADAM10 | 82.08% | 97.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.77% | 96.90% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.66% | 96.43% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.00% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Periploca graeca |
| PubChem | 73003622 |
| LOTUS | LTS0069467 |
| wikiData | Q104951443 |