9,10-dimethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indol-7-ol
| Internal ID | ba09a51f-8964-456b-a1ac-3c712a9cf4a8 |
| Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Homolycorine-type amaryllidaceae alkaloids |
| IUPAC Name | 9,10-dimethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indol-7-ol |
| SMILES (Canonical) | CN1CCC2=CCC3C(C21)C4=CC(=C(C=C4C(O3)O)OC)OC |
| SMILES (Isomeric) | CN1CCC2=CCC3C(C21)C4=CC(=C(C=C4C(O3)O)OC)OC |
| InChI | InChI=1S/C18H23NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-18,20H,5-7H2,1-3H3 |
| InChI Key | VHYYSQODIQWPDO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 1.20 |
| FT-0649771 |
![2D Structure of 9,10-dimethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indol-7-ol](https://plantaedb.com/storage/docs/compounds/2023/11/910-dimethoxy-1-methyl-355a711b11c-hexahydro-2h-isochromeno34-gindol-7-ol.jpg "2D Structure of 9,10-dimethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indol-7-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.16% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.58% | 90.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.99% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.66% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.40% | 86.33% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.87% | 93.40% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.61% | 97.36% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.22% | 89.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.96% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.66% | 92.94% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.28% | 94.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.01% | 90.24% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.02% | 91.03% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.77% | 89.62% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.75% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hymenocallis littoralis |
| Lapiedra martinezii |
| Lycoris radiata |
| Narcissus pseudonarcissus |
| PubChem | 4480710 |
| LOTUS | LTS0185251 |
| wikiData | Q105286690 |