(1S,4aS,7S,7aS)-1-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxy-7-hydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid
Internal ID | 11b186fc-8cdb-4f98-8845-5628e5e74475 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | (1S,4aS,7S,7aS)-1-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxy-7-hydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC1(CCC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)CO)O)O)OC(=O)C=CC4=CC=C(C=C4)O)O |
SMILES (Isomeric) | C[C@@]1(CC[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O)O |
InChI | InChI=1S/C25H30O12/c1-25(33)9-8-14-15(22(31)32)11-34-23(18(14)25)37-24-21(20(30)19(29)16(10-26)35-24)36-17(28)7-4-12-2-5-13(27)6-3-12/h2-7,11,14,16,18-21,23-24,26-27,29-30,33H,8-10H2,1H3,(H,31,32)/b7-4+/t14-,16-,18-,19-,20+,21-,23+,24+,25+/m1/s1 |
InChI Key | LWORTIDRRYUBBP-WYQBJTCVSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H30O12 |
Molecular Weight | 522.50 g/mol |
Exact Mass | 522.17372639 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.40% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.11% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.85% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.24% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.12% | 89.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 90.77% | 97.64% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.91% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.90% | 90.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.16% | 94.23% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 87.41% | 98.35% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.34% | 94.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.55% | 92.50% |
CHEMBL3194 | P02766 | Transthyretin | 86.01% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.97% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.01% | 93.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.77% | 94.08% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.66% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.61% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.54% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.04% | 95.89% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 84.03% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 83.77% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.54% | 95.93% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.09% | 94.97% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.05% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Avicennia marina |
PubChem | 163185261 |
LOTUS | LTS0264141 |
wikiData | Q105158457 |