9-Hydroxy-4-[(7-methoxy-2-oxochromen-8-yl)methyl]furo[3,2-g]chromen-7-one
| Internal ID | 2ba80191-a621-4eeb-bcea-61af6716bf0b |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens > 8-hydroxypsoralens |
| IUPAC Name | 9-hydroxy-4-[(7-methoxy-2-oxochromen-8-yl)methyl]furo[3,2-g]chromen-7-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1)C=CC(=O)O2)CC3=C4C=CC(=O)OC4=C(C5=C3C=CO5)O |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1)C=CC(=O)O2)CC3=C4C=CC(=O)OC4=C(C5=C3C=CO5)O |
| InChI | InChI=1S/C22H14O7/c1-26-16-5-2-11-3-6-17(23)28-20(11)15(16)10-14-12-4-7-18(24)29-22(12)19(25)21-13(14)8-9-27-21/h2-9,25H,10H2,1H3 |
| InChI Key | KNWSIJFQMWPQST-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C22H14O7 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.07395278 g/mol |
| Topological Polar Surface Area (TPSA) | 95.20 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
![2D Structure of 9-Hydroxy-4-[(7-methoxy-2-oxochromen-8-yl)methyl]furo[3,2-g]chromen-7-one](https://plantaedb.com/storage/docs/compounds/2023/11/9-hydroxy-4-7-methoxy-2-oxochromen-8-ylmethylfuro32-gchromen-7-one.jpg "2D Structure of 9-Hydroxy-4-[(7-methoxy-2-oxochromen-8-yl)methyl]furo[3,2-g]chromen-7-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.45% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.04% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.01% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.82% | 91.49% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 91.71% | 94.03% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.54% | 90.20% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.29% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.57% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.24% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.97% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.35% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.68% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.07% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cnidium monnieri |
| PubChem | 10715412 |
| LOTUS | LTS0260508 |
| wikiData | Q105143640 |