9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic Acid
Internal ID | 5caf959d-07ba-4296-bfb7-5b1ed3c0e686 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | 9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
SMILES (Canonical) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2O)(C)C(=O)O)C |
SMILES (Isomeric) | CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2O)(C)C(=O)O)C |
InChI | InChI=1S/C20H28O3/c1-12(2)13-6-7-15-14(10-13)16(21)11-17-19(15,3)8-5-9-20(17,4)18(22)23/h6-7,10,12,16-17,21H,5,8-9,11H2,1-4H3,(H,22,23) |
InChI Key | GPFVBJYXFRIOFB-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C20H28O3 |
Molecular Weight | 316.40 g/mol |
Exact Mass | 316.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 57.50 Ų |
XlogP | 4.30 |
CHEBI:182923 |
AKOS040737347 |
NCGC00380719-01 |
9-hydroxy-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic Acid |
NCGC00380719-01_C20H28O3_7-Hydroxyabieta-8,11,13-trien-18-oic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.73% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.45% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.93% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.51% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 91.16% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.51% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.96% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.10% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.12% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.15% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.40% | 90.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.75% | 89.62% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.49% | 95.71% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.26% | 95.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.00% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrus deodara |
Desmodium uncinatum |
Juniperus chinensis |
Juniperus sabina |
Larix kaempferi |
Pinus massoniana |
PubChem | 10448477 |
LOTUS | LTS0182815 |
wikiData | Q105014813 |