[4,5-Dihydroxy-6-[5-hydroxy-2-methyl-4-octanoyloxy-6-[[7,25,26-trihydroxy-24-(hydroxymethyl)-5-methyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-3-yl]oxy-2-methyloxan-3-yl] decanoate
| Internal ID | dba0a3fd-87b3-4966-af0a-ab054eb8b11e |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | [4,5-dihydroxy-6-[5-hydroxy-2-methyl-4-octanoyloxy-6-[[7,25,26-trihydroxy-24-(hydroxymethyl)-5-methyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-3-yl]oxy-2-methyloxan-3-yl] decanoate |
| SMILES (Canonical) | CCCCCCCCCC(=O)OC1C(OC(C(C1O)O)OC2C(OC(C(C2OC(=O)CCCCCCC)O)OC3C(OC4C(C3O)OC(=O)CCCCCCCCCC(OC5C(O4)C(C(C(O5)CO)O)O)CCCCC)C)C)C |
| SMILES (Isomeric) | CCCCCCCCCC(=O)OC1C(OC(C(C1O)O)OC2C(OC(C(C2OC(=O)CCCCCCC)O)OC3C(OC4C(C3O)OC(=O)CCCCCCCCCC(OC5C(O4)C(C(C(O5)CO)O)O)CCCCC)C)C)C |
| InChI | InChI=1S/C58H102O21/c1-7-10-13-15-17-22-27-31-40(60)74-49-35(4)69-55(46(66)45(49)65)78-51-37(6)70-56(48(68)52(51)75-41(61)32-26-20-14-11-8-2)77-50-36(5)71-57-54(47(50)67)76-42(62)33-28-23-19-16-18-21-25-30-38(29-24-12-9-3)72-58-53(79-57)44(64)43(63)39(34-59)73-58/h35-39,43-59,63-68H,7-34H2,1-6H3 |
| InChI Key | UFTNVQPMLJPZKQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C58H102O21 |
| Molecular Weight | 1135.40 g/mol |
| Exact Mass | 1134.69136026 g/mol |
| Topological Polar Surface Area (TPSA) | 294.00 Ų |
| XlogP | 9.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.76% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.88% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.08% | 96.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 95.69% | 92.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.99% | 99.17% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.23% | 100.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.13% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.36% | 95.50% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.90% | 97.79% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.82% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.61% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.20% | 93.56% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.04% | 97.36% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.58% | 91.81% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.26% | 97.25% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 86.27% | 90.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.66% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.60% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.00% | 95.89% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.66% | 92.62% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.01% | 94.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.41% | 95.56% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.15% | 96.21% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.43% | 92.08% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.26% | 93.67% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.23% | 82.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.93% | 99.23% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.77% | 96.61% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.55% | 100.00% |
| CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 80.40% | 98.57% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ipomoea purpurea |
| PubChem | 85092239 |
| LOTUS | LTS0036883 |
| wikiData | Q105272102 |