[(1S,4S,7S,8R,9R,10S,11R,14R)-8-acetyloxy-7-(furan-3-yl)-9-methyl-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadec-12-en-11-yl] acetate
Internal ID | bad6567f-01dd-40b3-b8b3-c18754a97a8e |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | [(1S,4S,7S,8R,9R,10S,11R,14R)-8-acetyloxy-7-(furan-3-yl)-9-methyl-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadec-12-en-11-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C=CC2C(=O)OCC23C1C4(C(CC3)C(=O)OC(C4OC(=O)C)C5=COC=C5)C |
SMILES (Isomeric) | CC(=O)O[C@@H]1C=C[C@H]2C(=O)OC[C@@]23[C@H]1[C@@]4([C@H](CC3)C(=O)O[C@H]([C@@H]4OC(=O)C)C5=COC=C5)C |
InChI | InChI=1S/C24H26O9/c1-12(25)31-17-5-4-16-21(27)30-11-24(16)8-6-15-22(28)33-18(14-7-9-29-10-14)20(32-13(2)26)23(15,3)19(17)24/h4-5,7,9-10,15-20H,6,8,11H2,1-3H3/t15-,16+,17-,18+,19-,20+,23+,24-/m1/s1 |
InChI Key | ODSSLHDHIUPAGJ-UXKLZPHWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H26O9 |
Molecular Weight | 458.50 g/mol |
Exact Mass | 458.15768240 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.91% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.90% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.52% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.50% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 90.35% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.69% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.60% | 99.23% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.80% | 82.69% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.63% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.55% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.51% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.31% | 97.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.05% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.11% | 91.19% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.62% | 92.62% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.48% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.36% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salvia splendens |
PubChem | 101939043 |
LOTUS | LTS0243745 |
wikiData | Q105190017 |