[(3S,5R,6R,8R,9S,10R,13R,14S,15S,17R)-3,5,6-trihydroxy-17-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] sulfate
Internal ID | 637809e8-b147-4b91-86d9-98a33d09425a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Hydroxy bile acids, alcohols and derivatives > Tetrahydroxy bile acids, alcohols and derivatives |
IUPAC Name | [(3S,5R,6R,8R,9S,10R,13R,14S,15S,17R)-3,5,6-trihydroxy-17-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] sulfate |
SMILES (Canonical) | CC(CCCC(C)C1CC(C2C1(CCC3C2CC(C4(C3(CCC(C4)O)C)O)O)C)OS(=O)(=O)[O-])CO |
SMILES (Isomeric) | C[C@@H](CCC[C@@H](C)[C@H]1C[C@@H]([C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@H]([C@@]4([C@@]3(CC[C@@H](C4)O)C)O)O)C)OS(=O)(=O)[O-])CO |
InChI | InChI=1S/C27H48O8S/c1-16(15-28)6-5-7-17(2)21-13-22(35-36(32,33)34)24-19-12-23(30)27(31)14-18(29)8-11-26(27,4)20(19)9-10-25(21,24)3/h16-24,28-31H,5-15H2,1-4H3,(H,32,33,34)/p-1/t16-,17+,18-,19+,20-,21+,22-,23+,24+,25+,26+,27-/m0/s1 |
InChI Key | XKKUSYWDICPRRU-DMSIPSRZSA-M |
Popularity | 0 references in papers |
Molecular Formula | C27H47O8S- |
Molecular Weight | 531.70 g/mol |
Exact Mass | 531.29916463 g/mol |
Topological Polar Surface Area (TPSA) | 156.00 Ų |
XlogP | 3.70 |
Atomic LogP (AlogP) | 2.98 |
H-Bond Acceptor | 8 |
H-Bond Donor | 4 |
Rotatable Bonds | 8 |
There are no found synonyms. |
![2D Structure of [(3S,5R,6R,8R,9S,10R,13R,14S,15S,17R)-3,5,6-trihydroxy-17-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] sulfate 2D Structure of [(3S,5R,6R,8R,9S,10R,13R,14S,15S,17R)-3,5,6-trihydroxy-17-[(2R,6S)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] sulfate](https://plantaedb.com/storage/docs/compounds/2023/07/8fcfa5e0-2658-11ee-b3e9-29374cbc894a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8387 | 83.87% |
Caco-2 | - | 0.7951 | 79.51% |
Blood Brain Barrier | + | 0.6885 | 68.85% |
Human oral bioavailability | + | 0.5143 | 51.43% |
Subcellular localzation | Lysosomes | 0.4792 | 47.92% |
OATP2B1 inhibitior | - | 0.5669 | 56.69% |
OATP1B1 inhibitior | + | 0.8730 | 87.30% |
OATP1B3 inhibitior | + | 0.9266 | 92.66% |
MATE1 inhibitior | - | 0.9800 | 98.00% |
OCT2 inhibitior | - | 0.8500 | 85.00% |
BSEP inhibitior | + | 0.5532 | 55.32% |
P-glycoprotein inhibitior | - | 0.5105 | 51.05% |
P-glycoprotein substrate | + | 0.6398 | 63.98% |
CYP3A4 substrate | + | 0.7475 | 74.75% |
CYP2C9 substrate | - | 0.5981 | 59.81% |
CYP2D6 substrate | - | 0.8146 | 81.46% |
CYP3A4 inhibition | - | 0.8943 | 89.43% |
CYP2C9 inhibition | - | 0.8171 | 81.71% |
CYP2C19 inhibition | - | 0.7573 | 75.73% |
CYP2D6 inhibition | - | 0.8922 | 89.22% |
CYP1A2 inhibition | - | 0.7513 | 75.13% |
CYP2C8 inhibition | + | 0.4814 | 48.14% |
CYP inhibitory promiscuity | - | 0.9402 | 94.02% |
UGT catelyzed | + | 1.0000 | 100.00% |
Carcinogenicity (binary) | - | 0.5300 | 53.00% |
Carcinogenicity (trinary) | Non-required | 0.6572 | 65.72% |
Eye corrosion | - | 0.9645 | 96.45% |
Eye irritation | - | 0.9329 | 93.29% |
Skin irritation | - | 0.7549 | 75.49% |
Skin corrosion | - | 0.8808 | 88.08% |
Ames mutagenesis | - | 0.5815 | 58.15% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7289 | 72.89% |
Micronuclear | + | 0.5500 | 55.00% |
Hepatotoxicity | + | 0.5753 | 57.53% |
skin sensitisation | - | 0.8495 | 84.95% |
Respiratory toxicity | + | 0.8111 | 81.11% |
Reproductive toxicity | + | 0.8667 | 86.67% |
Mitochondrial toxicity | + | 0.6375 | 63.75% |
Nephrotoxicity | - | 0.7889 | 78.89% |
Acute Oral Toxicity (c) | III | 0.6222 | 62.22% |
Estrogen receptor binding | + | 0.6660 | 66.60% |
Androgen receptor binding | + | 0.7509 | 75.09% |
Thyroid receptor binding | - | 0.5085 | 50.85% |
Glucocorticoid receptor binding | + | 0.6875 | 68.75% |
Aromatase binding | + | 0.6079 | 60.79% |
PPAR gamma | + | 0.5294 | 52.94% |
Honey bee toxicity | - | 0.7037 | 70.37% |
Biodegradation | - | 0.6750 | 67.50% |
Crustacea aquatic toxicity | - | 0.5455 | 54.55% |
Fish aquatic toxicity | + | 0.9784 | 97.84% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.95% | 95.93% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 94.06% | 92.98% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.39% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.51% | 100.00% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.45% | 94.66% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.26% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.16% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 91.94% | 98.95% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.92% | 96.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.04% | 96.77% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.67% | 85.31% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.43% | 92.86% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.16% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.93% | 82.69% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.58% | 95.89% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.51% | 98.05% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.97% | 96.90% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 87.87% | 99.17% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.55% | 95.71% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.84% | 89.05% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.77% | 93.18% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.49% | 95.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.98% | 93.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.48% | 96.43% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 85.03% | 96.25% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 84.99% | 95.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.66% | 95.58% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.98% | 94.33% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.40% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.97% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.55% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.37% | 95.83% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.04% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.65% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.58% | 96.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.33% | 96.47% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.22% | 96.00% |
CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 81.07% | 94.05% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.92% | 90.71% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.65% | 99.18% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.50% | 98.59% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.39% | 91.03% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.25% | 96.95% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 80.11% | 100.00% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.11% | 100.00% |
CHEMBL3837 | P07711 | Cathepsin L | 80.02% | 96.61% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.02% | 97.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lippia origanoides |