(1R,16S)-10,21,25-trimethoxy-15,30-dimethyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaen-9-ol
Internal ID | ab88c936-7893-49ae-ae38-b6c5bbe7acda |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Ethers > Diarylethers |
IUPAC Name | (1R,16S)-10,21,25-trimethoxy-15,30-dimethyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaen-9-ol |
SMILES (Canonical) | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C6C(CC7=CC(=C(C=C7)OC)O3)N(CCC6=CC(=C5O)OC)C)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C3C=C2[C@H]1CC4=CC=C(C=C4)OC5=C6[C@H](CC7=CC(=C(C=C7)OC)O3)N(CCC6=CC(=C5O)OC)C)OC |
InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-37-35-25(20-34(43-5)36(37)40)13-15-39(2)29(35)17-23-8-11-30(41-3)32(18-23)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29+/m1/s1 |
InChI Key | MYHQIVSWYXBWOC-WDYNHAJCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H40N2O6 |
Molecular Weight | 608.70 g/mol |
Exact Mass | 608.28863700 g/mol |
Topological Polar Surface Area (TPSA) | 72.90 Ų |
XlogP | 6.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.44% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.98% | 95.62% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 94.53% | 91.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.71% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.58% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.71% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.60% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.95% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 88.37% | 89.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.09% | 85.14% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 87.36% | 82.38% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.30% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.26% | 92.94% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.19% | 93.40% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.38% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.30% | 94.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.94% | 95.78% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.44% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.56% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 83.44% | 98.75% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 82.86% | 90.95% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.83% | 100.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.33% | 89.50% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.99% | 93.99% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.25% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cissampelos pareira |
PubChem | 162885512 |
LOTUS | LTS0063819 |
wikiData | Q105174907 |