(1S,3S)-5-[5-(2-amino-2-carboxyethyl)-1-methylimidazol-4-yl]sulfanyl-6,8-dihydroxy-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
Internal ID | 47f5c105-d71a-4253-9635-abfe07de746f |
Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives > Benzylisoquinolines |
IUPAC Name | (1S,3S)-5-[5-(2-amino-2-carboxyethyl)-1-methylimidazol-4-yl]sulfanyl-6,8-dihydroxy-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
SMILES (Canonical) | CN1C=NC(=C1CC(C(=O)O)N)SC2=C(C=C(C3=C2CC(NC3CC4=CC=C(C=C4)O)C(=O)O)O)O |
SMILES (Isomeric) | CN1C=NC(=C1CC(C(=O)O)N)SC2=C(C=C(C3=C2C[C@H](N[C@H]3CC4=CC=C(C=C4)O)C(=O)O)O)O |
InChI | InChI=1S/C24H26N4O7S/c1-28-10-26-22(17(28)8-14(25)23(32)33)36-21-13-7-16(24(34)35)27-15(20(13)18(30)9-19(21)31)6-11-2-4-12(29)5-3-11/h2-5,9-10,14-16,27,29-31H,6-8,25H2,1H3,(H,32,33)(H,34,35)/t14?,15-,16-/m0/s1 |
InChI Key | BBIABWPNIDKRLX-YVZMLIKISA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H26N4O7S |
Molecular Weight | 514.60 g/mol |
Exact Mass | 514.15222035 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | -3.20 |
NSC622005 |
DTXSID50909473 |
NSC-622005 |
3-Isoquinolinecarboxylic acid,2,3,4-tetrahydro-6,8-dihydroxy-1-[(4-hydroxy phenyl)methyl]-, [1S-[1.alpha.,3.alpha.,5(R*)]]- |
5-{[5-(2-Amino-2-carboxyethyl)-1-methyl-1H-imidazol-4-yl]sulfanyl}-6,8-dihydroxy-1-[(4-hydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.64% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.34% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 98.68% | 98.95% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 96.76% | 93.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.22% | 99.17% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.14% | 97.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.02% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.10% | 99.15% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 90.07% | 95.69% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.06% | 94.45% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.28% | 92.68% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.74% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.25% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.06% | 86.33% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 85.72% | 99.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.62% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.30% | 98.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.11% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.02% | 94.00% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.54% | 85.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.63% | 90.24% |
CHEMBL3891 | P07384 | Calpain 1 | 81.52% | 93.04% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.66% | 92.29% |
CHEMBL236 | P41143 | Delta opioid receptor | 80.53% | 99.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.33% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.10% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.07% | 91.71% |
CHEMBL233 | P35372 | Mu opioid receptor | 80.01% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asparagus officinalis |
PubChem | 360123 |
LOTUS | LTS0176846 |
wikiData | Q105307198 |