(1S,14R)-11,14-dihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-one
Internal ID | 885bbe40-5af9-4e32-bf7f-38c26c6232f8 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Rotenoids > Rotenones |
IUPAC Name | (1S,14R)-11,14-dihydroxy-17,18-dimethoxy-7,7-dimethyl-2,8,21-trioxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-3(12),4(9),5,10,15,17,19-heptaen-13-one |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=C(C3=C2OC4COC5=CC(=C(C=C5C4(C3=O)O)OC)OC)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=C(C3=C2O[C@H]4COC5=CC(=C(C=C5[C@@]4(C3=O)O)OC)OC)O)C |
InChI | InChI=1S/C23H22O8/c1-22(2)6-5-11-14(31-22)8-13(24)19-20(11)30-18-10-29-15-9-17(28-4)16(27-3)7-12(15)23(18,26)21(19)25/h5-9,18,24,26H,10H2,1-4H3/t18-,23+/m0/s1 |
InChI Key | OFLCPNIRDVOOEZ-FDDCHVKYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H22O8 |
Molecular Weight | 426.40 g/mol |
Exact Mass | 426.13146766 g/mol |
Topological Polar Surface Area (TPSA) | 104.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.11% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.56% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.34% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.04% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.99% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.58% | 90.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.03% | 94.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.71% | 91.19% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.59% | 96.77% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.12% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.75% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.15% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.67% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 87.44% | 98.95% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.25% | 83.82% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.07% | 92.62% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.67% | 93.40% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.45% | 99.23% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.22% | 97.14% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 85.20% | 82.67% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.15% | 89.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.87% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.56% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.43% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 83.32% | 98.75% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.95% | 91.07% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.39% | 100.00% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.18% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amorpha fruticosa |
Tephrosia candida |
Tephrosia sinapou |
Tephrosia villosa |
Tephrosia viridiflora |
PubChem | 124355889 |
LOTUS | LTS0120995 |
wikiData | Q104399962 |