[(1R,3S,5R,6S)-6-[(Z)-but-2-en-2-yl]oxycarbonyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (1S,3S,6R,7S,8S,9R,12R,14R,16S,18S,21Z,25S,27R)-6,15,21,28-tetramethyl-5,10,20,23-tetraoxo-8-phenyl-4,11,19,24-tetraoxa-15,28-diazahexacyclo[23.3.1.114,18.03,27.06,9.012,16]triacont-21-ene-7-carboxylate
Internal ID | 4d1de4bb-8095-4af6-bb92-94fbafed4ea4 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Hexacarboxylic acids and derivatives |
IUPAC Name | [(1R,3S,5R,6S)-6-[(Z)-but-2-en-2-yl]oxycarbonyl-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (1S,3S,6R,7S,8S,9R,12R,14R,16S,18S,21Z,25S,27R)-6,15,21,28-tetramethyl-5,10,20,23-tetraoxo-8-phenyl-4,11,19,24-tetraoxa-15,28-diazahexacyclo[23.3.1.114,18.03,27.06,9.012,16]triacont-21-ene-7-carboxylate |
SMILES (Canonical) | CC=C(C)OC(=O)C1CC2CC(CC1N2C)OC(=O)C3C(C4C3(C(=O)OC5CC6CC(CC5N6C)OC(=O)C=C(C(=O)OC7CC8CC(C(C7)N8C)OC4=O)C)C)C9=CC=CC=C9 |
SMILES (Isomeric) | C/C=C(/C)\OC(=O)[C@H]1C[C@@H]2C[C@@H](C[C@H]1N2C)OC(=O)[C@H]3[C@@H]([C@@H]4[C@@]3(C(=O)O[C@H]5C[C@@H]6C[C@@H](C[C@H]5N6C)OC(=O)/C=C(\C(=O)O[C@H]7C[C@@H]8C[C@H]([C@H](C7)N8C)OC4=O)/C)C)C9=CC=CC=C9 |
InChI | InChI=1S/C48H61N3O12/c1-8-25(3)58-44(54)33-18-27-15-31(21-34(33)49(27)5)61-45(55)41-40(26-12-10-9-11-13-26)42-46(56)62-37-19-29-17-32(23-35(37)50(29)6)60-43(53)24(2)14-39(52)59-30-16-28-20-38(36(22-30)51(28)7)63-47(57)48(41,42)4/h8-14,27-38,40-42H,15-23H2,1-7H3/b24-14-,25-8-/t27-,28-,29+,30-,31-,32-,33-,34+,35-,36+,37+,38-,40-,41+,42-,48+/m0/s1 |
InChI Key | KMPLMDQWOSMUKO-JVLNXZAUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H61N3O12 |
Molecular Weight | 872.00 g/mol |
Exact Mass | 871.42552439 g/mol |
Topological Polar Surface Area (TPSA) | 168.00 Ų |
XlogP | 5.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.94% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.79% | 91.11% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 94.39% | 94.62% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 94.26% | 94.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.97% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.65% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.48% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 90.00% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.89% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.14% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 87.03% | 97.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.43% | 96.47% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 86.40% | 94.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.54% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.55% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.21% | 94.45% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.66% | 93.65% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.59% | 85.14% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.13% | 92.97% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.16% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crotalaria grahamiana |
Schizanthus grahamii |
PubChem | 163104746 |
LOTUS | LTS0258500 |
wikiData | Q105143127 |