8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-ol
| Internal ID | bf0f6303-70b2-452a-8203-43ced4fee613 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Pyranochromenes |
| IUPAC Name | 8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-ol |
| SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2OCC(C3)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2OCC(C3)O)C |
| InChI | InChI=1S/C14H16O3/c1-14(2)6-5-11-12(17-14)4-3-9-7-10(15)8-16-13(9)11/h3-6,10,15H,7-8H2,1-2H3 |
| InChI Key | KAZSRFGQIWPLLH-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.109944368 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 2.20 |
| BDBM50496211 |
![2D Structure of 8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-ol](https://plantaedb.com/storage/docs/compounds/2023/11/88-dimethyl-34-dihydro-2h-pyrano23-fchromen-3-ol.jpg "2D Structure of 8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.18% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.10% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.53% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.31% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.55% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.12% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.77% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.43% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.31% | 89.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.66% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.61% | 95.71% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.45% | 90.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycyrrhiza glabra |
| PubChem | 76321811 |
| LOTUS | LTS0071518 |
| wikiData | Q105138058 |