2-[4,5-Dihydroxy-6-[8-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | e1fc61c4-e64d-40e5-81b3-f47b0d59c4d5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-6-[8-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC7C6(C(C8(O7)CCC(CO8)CO)C)O)C)C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OC3CCC4(C5CCC6(C(C5CC=C4C3)CC7C6(C(C8(O7)CCC(CO8)CO)C)O)C)C)CO)O)O)O |
InChI | InChI=1S/C39H62O14/c1-18-28(42)29(43)31(45)34(49-18)52-33-26(16-41)51-35(32(46)30(33)44)50-22-8-10-36(3)21(13-22)5-6-23-24(36)9-11-37(4)25(23)14-27-39(37,47)19(2)38(53-27)12-7-20(15-40)17-48-38/h5,18-20,22-35,40-47H,6-17H2,1-4H3 |
InChI Key | ZKERPGLUVQRWAW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H62O14 |
Molecular Weight | 754.90 g/mol |
Exact Mass | 754.41395665 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of 2-[4,5-Dihydroxy-6-[8-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[4,5-Dihydroxy-6-[8-hydroxy-5'-(hydroxymethyl)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/878efae0-848f-11ee-a9b4-65a9e56433fe.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.97% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.87% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.56% | 97.25% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.47% | 91.49% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.33% | 95.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.88% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.71% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.33% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.40% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.23% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.76% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.63% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.42% | 95.89% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 86.62% | 94.23% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.65% | 96.61% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.68% | 97.53% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.59% | 91.71% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.51% | 94.08% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.29% | 94.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.68% | 94.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.14% | 93.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.13% | 92.62% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.05% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.75% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Smilax menispermoidea |
PubChem | 162969755 |
LOTUS | LTS0165986 |
wikiData | Q105378406 |