(2R)-5-hydroxy-7-methoxy-2-[4-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one
Internal ID | b92f711d-531c-44c9-9a00-8a0ebd2bba70 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | (2R)-5-hydroxy-7-methoxy-2-[4-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)[C@H]2CC(=O)C3=C(C=C(C=C3O2)OC)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C23H26O11/c1-30-11-6-12(25)19-13(26)8-15(32-17(19)7-11)10-3-4-14(31-2)16(5-10)33-23-22(29)21(28)20(27)18(9-24)34-23/h3-7,15,18,20-25,27-29H,8-9H2,1-2H3/t15-,18-,20-,21+,22-,23-/m1/s1 |
InChI Key | VHGJMSVFUPCQGC-BHTFSWEFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26O11 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 164.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.15% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.04% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.69% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.75% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.78% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 94.41% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.32% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.49% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.90% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.28% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.12% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.89% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.39% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.29% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.79% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.64% | 94.45% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.52% | 97.36% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.33% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.21% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.58% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.28% | 95.89% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.25% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prunus dulcis |
PubChem | 162887360 |
LOTUS | LTS0163214 |
wikiData | Q105286409 |