6-[[9,10-Dibenzoyloxy-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid
Internal ID | ca794d7c-aef5-4beb-9493-51143ea64665 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | 6-[[9,10-dibenzoyloxy-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C1OC(=O)C6=CC=CC=C6)OC(=O)C7=CC=CC=C7)CO)O)C)C)(C)C)OC8C(C(C(C(O8)C(=O)O)O)OC9C(C(C(CO9)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C |
SMILES (Isomeric) | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(C(C1OC(=O)C6=CC=CC=C6)OC(=O)C7=CC=CC=C7)CO)O)C)C)(C)C)OC8C(C(C(C(O8)C(=O)O)O)OC9C(C(C(CO9)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C |
InChI | InChI=1S/C61H84O22/c1-56(2)24-32-31-18-19-36-58(5)22-21-38(78-55-47(81-54-43(70)41(68)40(67)34(26-62)77-54)45(44(71)46(80-55)50(72)73)79-53-42(69)39(66)33(64)27-76-53)57(3,4)35(58)20-23-59(36,6)60(31,7)25-37(65)61(32,28-63)49(83-52(75)30-16-12-9-13-17-30)48(56)82-51(74)29-14-10-8-11-15-29/h8-18,32-49,53-55,62-71H,19-28H2,1-7H3,(H,72,73) |
InChI Key | PQSYDERHCQJURP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C61H84O22 |
Molecular Weight | 1169.30 g/mol |
Exact Mass | 1168.54542430 g/mol |
Topological Polar Surface Area (TPSA) | 348.00 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of 6-[[9,10-Dibenzoyloxy-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid 2D Structure of 6-[[9,10-Dibenzoyloxy-8-hydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3-hydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxane-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/85f30540-83ca-11ee-b81e-9b6b2148c897.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.92% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 94.24% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.01% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.40% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.70% | 96.09% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 90.56% | 92.98% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.44% | 89.44% |
CHEMBL5028 | O14672 | ADAM10 | 89.39% | 97.50% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.34% | 96.21% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.72% | 95.83% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.67% | 91.07% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.17% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 87.07% | 89.67% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.59% | 95.93% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.92% | 95.50% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.54% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.35% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.16% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.59% | 99.23% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.47% | 91.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Barringtonia acutangula |
PubChem | 72775073 |
LOTUS | LTS0096279 |
wikiData | Q105213428 |