[(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-[[(1R,2R,4S,6R,7S,8R,9S,12R,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate
Internal ID | 125791e7-ef06-4a68-9bb6-34cab342f610 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | [(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-[[(1R,2R,4S,6R,7S,8R,9S,12R,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)COC(=O)C)O)O)OC7C(C(C(C(O7)C)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@H]3[C@@]2(CC[C@@H]4[C@@H]3CC=C5[C@@]4([C@@H](C[C@@H](C5)O)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)COC(=O)C)O)O)O[C@H]7[C@@H]([C@@H]([C@H]([C@@H](O7)C)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)OC |
InChI | InChI=1S/C48H78O20/c1-20(18-62-43-40(58)38(56)35(53)30(17-49)64-43)10-13-48(60-7)21(2)33-29(68-48)16-28-26-9-8-24-14-25(51)15-32(47(24,6)27(26)11-12-46(28,33)5)66-45-42(39(57)36(54)31(65-45)19-61-23(4)50)67-44-41(59)37(55)34(52)22(3)63-44/h8,20-22,25-45,49,51-59H,9-19H2,1-7H3/t20-,21+,22+,25-,26+,27-,28-,29+,30-,31-,32-,33+,34+,35-,36+,37-,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,48-/m1/s1 |
InChI Key | OAFYYFCLWIEHGB-VVTJSXBHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H78O20 |
Molecular Weight | 975.10 g/mol |
Exact Mass | 974.50864487 g/mol |
Topological Polar Surface Area (TPSA) | 302.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-[[(1R,2R,4S,6R,7S,8R,9S,12R,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate 2D Structure of [(2R,3R,4S,5R,6R)-3,4-dihydroxy-6-[[(1R,2R,4S,6R,7S,8R,9S,12R,13R,14R,16R)-16-hydroxy-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-14-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/836bb800-8708-11ee-9329-27ca3decaf14.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.07% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.36% | 95.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.66% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.79% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.58% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.45% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 93.26% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.78% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.47% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.33% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.80% | 94.73% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.23% | 92.50% |
CHEMBL2581 | P07339 | Cathepsin D | 89.47% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.28% | 93.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.43% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.48% | 99.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.13% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.59% | 97.50% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.48% | 96.43% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.79% | 93.04% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.77% | 94.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.58% | 89.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.53% | 91.19% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 80.52% | 98.46% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.36% | 85.14% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.03% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ruscus aculeatus |
PubChem | 162852269 |
LOTUS | LTS0070378 |
wikiData | Q105188648 |