methyl 2-[4-[acetyloxy(furan-3-yl)methyl]-7a-formyl-4-methyl-2-oxo-3-propanoyl-3a,5,6,7-tetrahydro-3H-1-benzofuran-7-yl]-2,8,8-trimethyl-3-oxo-6-oxabicyclo[3.2.1]octane-7-carboxylate
Internal ID | c888f954-8bfe-42dc-be4d-ccb1f50e483f |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | methyl 2-[4-[acetyloxy(furan-3-yl)methyl]-7a-formyl-4-methyl-2-oxo-3-propanoyl-3a,5,6,7-tetrahydro-3H-1-benzofuran-7-yl]-2,8,8-trimethyl-3-oxo-6-oxabicyclo[3.2.1]octane-7-carboxylate |
SMILES (Canonical) | CCC(=O)C1C2C(CCC(C2(OC1=O)C=O)C3(C4C(OC(C4(C)C)CC3=O)C(=O)OC)C)(C)C(C5=COC=C5)OC(=O)C |
SMILES (Isomeric) | CCC(=O)C1C2C(CCC(C2(OC1=O)C=O)C3(C4C(OC(C4(C)C)CC3=O)C(=O)OC)C)(C)C(C5=COC=C5)OC(=O)C |
InChI | InChI=1S/C32H40O11/c1-8-18(35)22-24-30(5,26(41-16(2)34)17-10-12-40-14-17)11-9-19(32(24,15-33)43-27(22)37)31(6)20(36)13-21-29(3,4)25(31)23(42-21)28(38)39-7/h10,12,14-15,19,21-26H,8-9,11,13H2,1-7H3 |
InChI Key | UZGWMMOVPDKSHU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H40O11 |
Molecular Weight | 600.70 g/mol |
Exact Mass | 600.25706209 g/mol |
Topological Polar Surface Area (TPSA) | 153.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.46% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.19% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.08% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.83% | 90.17% |
CHEMBL4072 | P07858 | Cathepsin B | 95.20% | 93.67% |
CHEMBL2581 | P07339 | Cathepsin D | 91.89% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.20% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.78% | 92.62% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.16% | 95.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.61% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.91% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.70% | 95.56% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.90% | 94.80% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 83.78% | 98.59% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.06% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.05% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.00% | 91.19% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.98% | 94.73% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.80% | 94.75% |
CHEMBL3837 | P07711 | Cathepsin L | 82.20% | 96.61% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.91% | 92.97% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.93% | 97.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.68% | 95.83% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.00% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela salvadorensis |
PubChem | 162941486 |
LOTUS | LTS0270411 |
wikiData | Q105282194 |