[3,5-dihydroxy-2-[[17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxan-4-yl] acetate
Internal ID | 2ab1dea5-8db5-4b36-afcd-a2d395f0024a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [3,5-dihydroxy-2-[[17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxan-4-yl] acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CCC5(C4CCC3(C2C(C)C(CC=C(C)C)O)C)C)OC6C(C(C(C(O6)CO)O)O)O)O)OC(=O)C)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CCC5(C4CCC3(C2C(C)C(CC=C(C)C)O)C)C)OC6C(C(C(C(O6)CO)O)O)O)O)OC(=O)C)O |
InChI | InChI=1S/C41H66O13/c1-19(2)8-11-28(44)20(3)31-29(53-39-36(49)37(51-22(5)43)32(45)21(4)50-39)17-27-25-10-9-23-16-24(12-14-40(23,6)26(25)13-15-41(27,31)7)52-38-35(48)34(47)33(46)30(18-42)54-38/h8-9,20-21,24-39,42,44-49H,10-18H2,1-7H3 |
InChI Key | BOPLCQZRUUPBAU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H66O13 |
Molecular Weight | 767.00 g/mol |
Exact Mass | 766.45034216 g/mol |
Topological Polar Surface Area (TPSA) | 205.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
![2D Structure of [3,5-dihydroxy-2-[[17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxan-4-yl] acetate 2D Structure of [3,5-dihydroxy-2-[[17-(3-hydroxy-6-methylhept-5-en-2-yl)-10,13-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxan-4-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/825b6850-84e7-11ee-ae19-c59582a21592.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.80% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.67% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.37% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.22% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.17% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.11% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.80% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.81% | 97.09% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.78% | 94.08% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.92% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.37% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.05% | 91.24% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.83% | 98.10% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.75% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.64% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.36% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.77% | 93.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.78% | 91.07% |
CHEMBL5028 | O14672 | ADAM10 | 83.30% | 97.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.46% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.35% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.28% | 89.67% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.16% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.97% | 91.19% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.87% | 89.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.75% | 95.56% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.31% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.98% | 96.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.80% | 100.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.25% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum candicans |
PubChem | 85352345 |
LOTUS | LTS0205925 |
wikiData | Q104939378 |