(3a,9,10,11,12-Pentaacetyloxy-2-hydroxy-2,5,8,8,12-pentamethyl-4-oxo-1,3,5,9,10,11-hexahydrocyclopenta[12]annulen-1-yl) benzoate
| Internal ID | 42ae7c87-e7eb-47ae-82cb-6b9055ee806d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Jatrophane and cyclojatrophane diterpenoids |
| IUPAC Name | (3a,9,10,11,12-pentaacetyloxy-2-hydroxy-2,5,8,8,12-pentamethyl-4-oxo-1,3,5,9,10,11-hexahydrocyclopenta[12]annulen-1-yl) benzoate |
| SMILES (Canonical) | CC1C=CC(C(C(C(C(C=C2C(C(CC2(C1=O)OC(=O)C)(C)O)OC(=O)C3=CC=CC=C3)(C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)(C)C |
| SMILES (Isomeric) | CC1C=CC(C(C(C(C(C=C2C(C(CC2(C1=O)OC(=O)C)(C)O)OC(=O)C3=CC=CC=C3)(C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)(C)C |
| InChI | InChI=1S/C37H46O14/c1-20-16-17-34(7,8)31(47-22(3)39)28(46-21(2)38)32(48-23(4)40)36(10,50-24(5)41)18-27-30(49-33(44)26-14-12-11-13-15-26)35(9,45)19-37(27,29(20)43)51-25(6)42/h11-18,20,28,30-32,45H,19H2,1-10H3 |
| InChI Key | ZXGXFXYQGFBFDO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H46O14 |
| Molecular Weight | 714.80 g/mol |
| Exact Mass | 714.28875614 g/mol |
| Topological Polar Surface Area (TPSA) | 195.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of (3a,9,10,11,12-Pentaacetyloxy-2-hydroxy-2,5,8,8,12-pentamethyl-4-oxo-1,3,5,9,10,11-hexahydrocyclopenta[12]annulen-1-yl) benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/824ef7e0-871d-11ee-905c-fb449eadb342.jpg "2D Structure of (3a,9,10,11,12-Pentaacetyloxy-2-hydroxy-2,5,8,8,12-pentamethyl-4-oxo-1,3,5,9,10,11-hexahydrocyclopenta[12]annulen-1-yl) benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.05% | 90.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.67% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.49% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.84% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.76% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.15% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.68% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.21% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.17% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 84.50% | 97.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.90% | 82.69% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.58% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.18% | 90.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.68% | 93.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.03% | 85.14% |
| CHEMBL264 | Q9Y5N1 | Histamine H3 receptor | 80.00% | 91.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia hyssopifolia |
| PubChem | 74992853 |
| LOTUS | LTS0185712 |
| wikiData | Q105385533 |