[4,5-Dihydroxy-2-[[7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-5-yl]oxy]-6-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 90a418d1-5a93-44b3-8f95-446a048dd12c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | [4,5-dihydroxy-2-[[7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-5-yl]oxy]-6-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C=C(C3C2C=COC3OC4C(C(C(C(O4)CO)O)O)O)CO)OC(=O)C=CC5=CC=C(C=C5)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C=C(C3C2C=COC3OC4C(C(C(C(O4)CO)O)O)O)CO)OC(=O)C=CC5=CC=C(C=C5)O)O)O |
InChI | InChI=1S/C30H38O15/c1-13-22(35)25(38)27(44-20(34)7-4-14-2-5-16(33)6-3-14)30(41-13)42-18-10-15(11-31)21-17(18)8-9-40-28(21)45-29-26(39)24(37)23(36)19(12-32)43-29/h2-10,13,17-19,21-33,35-39H,11-12H2,1H3 |
InChI Key | YYHNQOISCKVABM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H38O15 |
Molecular Weight | 638.60 g/mol |
Exact Mass | 638.22107050 g/mol |
Topological Polar Surface Area (TPSA) | 234.00 Ų |
XlogP | -1.80 |
There are no found synonyms. |
![2D Structure of [4,5-Dihydroxy-2-[[7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-5-yl]oxy]-6-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [4,5-Dihydroxy-2-[[7-(hydroxymethyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-5-yl]oxy]-6-methyloxan-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/822e70f0-8671-11ee-a512-7b8937206782.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.18% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.22% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.97% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.09% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.05% | 95.56% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.51% | 91.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.37% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.00% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.72% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.48% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 84.43% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 83.58% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.35% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.14% | 86.92% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.51% | 93.10% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.10% | 89.67% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.82% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.47% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Verbascum nigrum |
PubChem | 74155540 |
LOTUS | LTS0046663 |
wikiData | Q105368653 |