(2R,3S,6S,8R,11R,12S,13R,15R,16R)-2,13-dihydroxy-15-[(2R)-6-hydroxy-6-methyl-4-oxoheptan-2-yl]-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxytetracyclo[9.7.0.03,8.012,16]octadec-1(18)-en-14-one
| Internal ID | 968e7364-31a9-402c-bbc2-6197dca36677 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | (2R,3S,6S,8R,11R,12S,13R,15R,16R)-2,13-dihydroxy-15-[(2R)-6-hydroxy-6-methyl-4-oxoheptan-2-yl]-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxytetracyclo[9.7.0.03,8.012,16]octadec-1(18)-en-14-one |
| SMILES (Canonical) | CC(CC(=O)CC(C)(C)O)C1C(=O)C(C2(C1(CC=C3C2CCC4C(C3O)CCC(C4(C)C)OC5C(C(C(CO5)O)O)O)C)C)O |
| SMILES (Isomeric) | C[C@H](CC(=O)CC(C)(C)O)[C@H]1C(=O)[C@@H]([C@@]2([C@@]1(CC=C3[C@H]2CC[C@@H]4[C@@H]([C@H]3O)CC[C@@H](C4(C)C)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O)O)C)C)O |
| InChI | InChI=1S/C35H56O10/c1-17(14-18(36)15-32(2,3)43)25-28(40)30(42)35(7)22-10-9-21-19(26(38)20(22)12-13-34(25,35)6)8-11-24(33(21,4)5)45-31-29(41)27(39)23(37)16-44-31/h12,17,19,21-27,29-31,37-39,41-43H,8-11,13-16H2,1-7H3/t17-,19+,21-,22-,23+,24+,25+,26-,27+,29-,30+,31+,34-,35-/m1/s1 |
| InChI Key | XWNVQJSABXXZKP-SAJNTDTPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H56O10 |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.38734798 g/mol |
| Topological Polar Surface Area (TPSA) | 174.00 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.35% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.85% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.95% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.60% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.02% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.07% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.37% | 89.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.61% | 91.07% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.38% | 97.14% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.76% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.65% | 85.14% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 85.36% | 92.78% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.12% | 97.28% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.78% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.70% | 94.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.02% | 90.08% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.51% | 95.89% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.29% | 96.77% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.13% | 93.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.01% | 92.50% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.73% | 86.92% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.33% | 92.88% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.26% | 94.45% |
| CHEMBL5028 | O14672 | ADAM10 | 80.74% | 97.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.44% | 89.50% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.34% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actaea podocarpa |
| PubChem | 16110016 |
| LOTUS | LTS0226755 |
| wikiData | Q105343638 |