[5-Formyl-6,14-dihydroxy-9-methyl-14-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate
Internal ID | b701790e-722e-4725-bfe4-ea93ff30255a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | [5-formyl-6,14-dihydroxy-9-methyl-14-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
SMILES (Canonical) | CC(=O)OC1C23CCC4C(C(CCC4(C2CCC(C3)C1(COC5C(C(C(C(O5)CO)O)O)O)O)C)O)C=O |
SMILES (Isomeric) | CC(=O)OC1C23CCC4C(C(CCC4(C2CCC(C3)C1(COC5C(C(C(C(O5)CO)O)O)O)O)C)O)C=O |
InChI | InChI=1S/C27H42O11/c1-13(30)37-24-26-8-5-16-15(10-28)17(31)6-7-25(16,2)19(26)4-3-14(9-26)27(24,35)12-36-23-22(34)21(33)20(32)18(11-29)38-23/h10,14-24,29,31-35H,3-9,11-12H2,1-2H3 |
InChI Key | VTTMFDBPZUELBX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H42O11 |
Molecular Weight | 542.60 g/mol |
Exact Mass | 542.27271215 g/mol |
Topological Polar Surface Area (TPSA) | 183.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [5-Formyl-6,14-dihydroxy-9-methyl-14-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate 2D Structure of [5-Formyl-6,14-dihydroxy-9-methyl-14-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/81f1b160-8328-11ee-aa2d-d1e3d945fab8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.09% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.78% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.66% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.66% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.90% | 96.61% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.71% | 95.50% |
CHEMBL237 | P41145 | Kappa opioid receptor | 90.29% | 98.10% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.10% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.40% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.45% | 96.77% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.42% | 92.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.20% | 94.33% |
CHEMBL233 | P35372 | Mu opioid receptor | 84.08% | 97.93% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.70% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.60% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.30% | 91.24% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.06% | 95.83% |
CHEMBL5028 | O14672 | ADAM10 | 82.34% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.26% | 93.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.66% | 92.86% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.51% | 95.38% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.25% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.20% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 81.00% | 98.95% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 80.83% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.74% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.62% | 86.33% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.44% | 96.33% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.03% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diplospora dubia |
PubChem | 162978027 |
LOTUS | LTS0079136 |
wikiData | Q105292999 |