10-Hydroxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one
| Internal ID | 2399fa82-4f2b-46f5-bc79-8a16c1ebc31d |
| Taxonomy | Alkaloids and derivatives > Aristolactams |
| IUPAC Name | 10-hydroxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one |
| SMILES (Canonical) | C1OC2=C(O1)C3=C4C(=C2)C(=O)N(C4=CC5=CC=CC=C53)O |
| SMILES (Isomeric) | C1OC2=C(O1)C3=C4C(=C2)C(=O)N(C4=CC5=CC=CC=C53)O |
| InChI | InChI=1S/C16H9NO4/c18-16-10-6-12-15(21-7-20-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(16)19/h1-6,19H,7H2 |
| InChI Key | QMZFJSBRZKZMTA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H9NO4 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.05315777 g/mol |
| Topological Polar Surface Area (TPSA) | 59.00 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 10-Hydroxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/819a2690-83ed-11ee-bcb7-d786cfe65336.jpg "2D Structure of 10-Hydroxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(19),2(6),7,11,13,15,17-heptaen-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.94% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.88% | 95.56% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.76% | 85.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.58% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.97% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.57% | 98.95% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.71% | 92.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.13% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.28% | 86.33% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.08% | 80.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.05% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.36% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper umbellatum |
| PubChem | 101862862 |
| LOTUS | LTS0210965 |
| wikiData | Q105224261 |