(2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-4-hydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy]oxan-2-yl]oxy-6-(hydroxymethyl)-2-[[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18S)-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | ae15ccb4-b4f2-4f38-89f4-8010a8fe2775 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3R,4S,5R,6R)-4-hydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3,4-bis[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy]oxan-2-yl]oxy-6-(hydroxymethyl)-2-[[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18S)-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]oxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(CO9)O)O)O)O)OC2C(C(C(C(O2)C)O)O)O)C)C)OC1(CCC(C)COC1C(C(C(C(O1)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O[C@H]8[C@@H]([C@H]([C@@H](CO8)O)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O)C)C)O[C@@]1(CC[C@@H](C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)OC |
InChI | InChI=1S/C62H104O31/c1-23(20-81-54-47(77)44(74)41(71)34(17-63)86-54)9-14-62(80-6)24(2)37-33(93-62)16-30-28-8-7-26-15-27(10-12-60(26,4)29(28)11-13-61(30,37)5)85-58-52(91-57-48(78)43(73)38(68)25(3)84-57)49(79)50(36(19-65)88-58)89-59-53(92-56-46(76)40(70)32(67)22-83-56)51(42(72)35(18-64)87-59)90-55-45(75)39(69)31(66)21-82-55/h23-59,63-79H,7-22H2,1-6H3/t23-,24+,25+,26+,27+,28-,29+,30+,31-,32-,33+,34-,35-,36-,37+,38+,39+,40+,41-,42-,43-,44+,45-,46-,47-,48-,49+,50+,51+,52-,53-,54-,55+,56+,57+,58-,59+,60+,61+,62-/m1/s1 |
InChI Key | YHVNCBGBSMUHPF-NVIOQSPDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C62H104O31 |
Molecular Weight | 1345.50 g/mol |
Exact Mass | 1344.6561565 g/mol |
Topological Polar Surface Area (TPSA) | 473.00 Ų |
XlogP | -3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.11% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.82% | 97.09% |
CHEMBL237 | P41145 | Kappa opioid receptor | 94.45% | 98.10% |
CHEMBL204 | P00734 | Thrombin | 94.06% | 96.01% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.38% | 97.93% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.26% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.94% | 94.45% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 92.85% | 92.98% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.46% | 92.86% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.19% | 97.29% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 90.63% | 95.36% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.31% | 95.58% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.76% | 97.25% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.56% | 89.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.53% | 100.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.38% | 98.05% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.16% | 96.21% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 88.84% | 97.86% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.31% | 96.77% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.92% | 92.94% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.85% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.85% | 93.18% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.42% | 92.88% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.75% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.65% | 100.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.74% | 98.46% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 83.44% | 92.38% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.21% | 97.31% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.03% | 91.24% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.72% | 95.89% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 82.19% | 92.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.19% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.18% | 96.43% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.03% | 95.50% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.88% | 94.75% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.38% | 97.79% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.24% | 91.65% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.11% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chlorophytum borivilianum |
Tribulus terrestris |
PubChem | 162961288 |
LOTUS | LTS0206810 |
wikiData | Q105348630 |