[(1R,2S,3R,5S,8S,9S,10S,11R,12R)-3,9,10-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate
Internal ID | 4e01915a-5d19-4749-9efb-b8283e4886ee |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | [(1R,2S,3R,5S,8S,9S,10S,11R,12R)-3,9,10-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCCC23C1C(C(C45C2C(CC(C4)C(=C)C5=O)O)(OC3)O)O)C |
SMILES (Isomeric) | CC(=O)OC[C@@]1(CCC[C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2[C@@H](C[C@H](C4)C(=C)C5=O)O)(OC3)O)O)C |
InChI | InChI=1S/C22H30O7/c1-11-13-7-14(24)15-20-6-4-5-19(3,9-28-12(2)23)16(20)18(26)22(27,29-10-20)21(15,8-13)17(11)25/h13-16,18,24,26-27H,1,4-10H2,2-3H3/t13-,14-,15+,16-,18+,19+,20-,21+,22-/m1/s1 |
InChI Key | XQPBZGQNCZAVQT-AJEWKEGKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H30O7 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.19915329 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of [(1R,2S,3R,5S,8S,9S,10S,11R,12R)-3,9,10-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate 2D Structure of [(1R,2S,3R,5S,8S,9S,10S,11R,12R)-3,9,10-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate](https://plantaedb.com/storage/docs/compounds/2023/11/806016f0-854f-11ee-b2fe-672c0655f7a1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.92% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.20% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.82% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.76% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.45% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.35% | 85.14% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.94% | 96.38% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.20% | 96.77% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.41% | 95.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.19% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.89% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.71% | 82.69% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 86.54% | 95.38% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.36% | 94.75% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.72% | 97.28% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.14% | 95.89% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.61% | 95.71% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.24% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.51% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.57% | 89.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.74% | 96.90% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.69% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.58% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon adenolomus |
Isodon enanderianus |
Isodon japonicus |
Isodon trichocarpus |
Isodon xerophilus |
PubChem | 14395565 |
LOTUS | LTS0046637 |
wikiData | Q105339932 |