8-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one
| Internal ID | 6d08b088-ba63-4a31-8385-a4b7df041d30 |
| Taxonomy | Alkaloids and derivatives > Indolonaphthyridine alkaloids |
| IUPAC Name | 8-[(2S,3R,4S,5S,6R)-3-[(2S,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| SMILES (Canonical) | C1C(C(C(O1)OC2C(C(C(OC2OC3=CN=C4C=CC(=O)N5C4=C3C6=CC=CC=C65)CO)O)O)O)(CO)O |
| SMILES (Isomeric) | C1[C@@]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CN=C4C=CC(=O)N5C4=C3C6=CC=CC=C65)CO)O)O)O)(CO)O |
| InChI | InChI=1S/C25H26N2O11/c28-8-15-19(31)20(32)21(38-24-22(33)25(34,9-29)10-35-24)23(37-15)36-14-7-26-12-5-6-16(30)27-13-4-2-1-3-11(13)17(14)18(12)27/h1-7,15,19-24,28-29,31-34H,8-10H2/t15-,19-,20+,21-,22+,23-,24+,25-/m1/s1 |
| InChI Key | XGGJLRIJRXMGJK-LEHRWSAJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H26N2O11 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.15365965 g/mol |
| Topological Polar Surface Area (TPSA) | 193.00 Ų |
| XlogP | -1.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.96% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.65% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.19% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.62% | 94.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.17% | 97.36% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 93.69% | 95.83% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.37% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.65% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.03% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.52% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.81% | 86.33% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 89.52% | 92.97% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.40% | 94.45% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 88.67% | 89.44% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.75% | 94.62% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.69% | 85.49% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.25% | 90.08% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.80% | 97.53% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.24% | 97.09% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 85.03% | 96.47% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.26% | 94.75% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.42% | 80.71% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.38% | 94.23% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.10% | 95.89% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 82.95% | 88.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.70% | 90.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 81.30% | 83.57% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.31% | 98.59% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.01% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ailanthus altissima |
| PubChem | 118729952 |
| LOTUS | LTS0103565 |
| wikiData | Q105327590 |